C8H5N3OS — CID 82403529
5-(1,3-thiazol-5-yl)pyrazine-2-carbaldehyde (PubChem CID 82403529) has the molecular formula C8H5N3OS and a molecular weight of 191.22 g/mol. Its IUPAC name is 5-(1,3-thiazol-5-yl)pyrazine-2-carbaldehyde.
| Compound Name | 5-(1,3-thiazol-5-yl)pyrazine-2-carbaldehyde |
|---|---|
| PubChem CID | 82403529 |
| Molecular Formula | C8H5N3OS |
| Molecular Weight | 191.22 g/mol |
| Exact Mass | 191.02 |
| IUPAC Name | 5-(1,3-thiazol-5-yl)pyrazine-2-carbaldehyde |
| SMILES | O=Cc1cnc(-c2cncs2)cn1 |
| InChI | InChI=1S/C8H5N3OS/c12-4-6-1-11-7(2-10-6)8-3-9-5-13-8/h1-5H |
| InChIKey | FBIALXHWMMKGPH-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 55.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.22 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|