About 2-(5-oxo-6,7-dihydrocyclopenta[d]pyrimidin-2-yl)acetamide
2-(5-oxo-6,7-dihydrocyclopenta[d]pyrimidin-2-yl)acetamide (PubChem CID 82403669) has the molecular formula C9H9N3O2
and a molecular weight of 191.19 g/mol. Its IUPAC name is 2-(5-oxo-6,7-dihydrocyclopenta[d]pyrimidin-2-yl)acetamide.
Molecular Properties
| Compound Name | 2-(5-oxo-6,7-dihydrocyclopenta[d]pyrimidin-2-yl)acetamide |
| PubChem CID | 82403669 |
| Molecular Formula | C9H9N3O2 |
| Molecular Weight | 191.19 g/mol |
| Exact Mass | 191.07 |
| IUPAC Name | 2-(5-oxo-6,7-dihydrocyclopenta[d]pyrimidin-2-yl)acetamide |
| SMILES | NC(=O)Cc1ncc2c(n1)CCC2=O |
| InChI | InChI=1S/C9H9N3O2/c10-8(14)3-9-11-4-5-6(12-9)1-2-7(5)13/h4H,1-3H2,(H2,10,14) |
| InChIKey | JHEXQUFZRFZWOD-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 85.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.19 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(5-oxo-6,7-dihydrocyclopenta[d]pyrimidin-2-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5-oxo-6,7-dihydrocyclopenta[d]pyrimidin-2-yl)acetamide?
The IUPAC name of 2-(5-oxo-6,7-dihydrocyclopenta[d]pyrimidin-2-yl)acetamide (CID 82403669) is 2-(5-oxo-6,7-dihydrocyclopenta[d]pyrimidin-2-yl)acetamide.
What is the SMILES notation for 2-(5-oxo-6,7-dihydrocyclopenta[d]pyrimidin-2-yl)acetamide?
The canonical SMILES for 2-(5-oxo-6,7-dihydrocyclopenta[d]pyrimidin-2-yl)acetamide is NC(=O)Cc1ncc2c(n1)CCC2=O.
What is the InChIKey of 2-(5-oxo-6,7-dihydrocyclopenta[d]pyrimidin-2-yl)acetamide?
The InChIKey is JHEXQUFZRFZWOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9N3O2/c10-8(14)3-9-11-4-5-6(12-9)1-2-7(5)13/h4H,1-3H2,(H2,10,14).
What are the key properties of 2-(5-oxo-6,7-dihydrocyclopenta[d]pyrimidin-2-yl)acetamide?
2-(5-oxo-6,7-dihydrocyclopenta[d]pyrimidin-2-yl)acetamide has a molecular weight of 191.19 g/mol, XLogP of -0.37, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-oxo-6,7-dihydrocyclopenta[d]pyrimidin-2-yl)acetamide is sourced from PubChem (CID 82403669), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).