About [6-(2-methyl-1,3-oxazol-5-yl)pyrimidin-4-yl]methanamine
[6-(2-methyl-1,3-oxazol-5-yl)pyrimidin-4-yl]methanamine (PubChem CID 82404090) has the molecular formula C9H10N4O
and a molecular weight of 190.21 g/mol. Its IUPAC name is [6-(2-methyl-1,3-oxazol-5-yl)pyrimidin-4-yl]methanamine.
Molecular Properties
| Compound Name | [6-(2-methyl-1,3-oxazol-5-yl)pyrimidin-4-yl]methanamine |
| PubChem CID | 82404090 |
| Molecular Formula | C9H10N4O |
| Molecular Weight | 190.21 g/mol |
| Exact Mass | 190.09 |
| IUPAC Name | [6-(2-methyl-1,3-oxazol-5-yl)pyrimidin-4-yl]methanamine |
| SMILES | Cc1ncc(-c2cc(CN)ncn2)o1 |
| InChI | InChI=1S/C9H10N4O/c1-6-11-4-9(14-6)8-2-7(3-10)12-5-13-8/h2,4-5H,3,10H2,1H3 |
| InChIKey | FFCKICBXUPJHNT-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 77.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.21 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [6-(2-methyl-1,3-oxazol-5-yl)pyrimidin-4-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [6-(2-methyl-1,3-oxazol-5-yl)pyrimidin-4-yl]methanamine?
The IUPAC name of [6-(2-methyl-1,3-oxazol-5-yl)pyrimidin-4-yl]methanamine (CID 82404090) is [6-(2-methyl-1,3-oxazol-5-yl)pyrimidin-4-yl]methanamine.
What is the SMILES notation for [6-(2-methyl-1,3-oxazol-5-yl)pyrimidin-4-yl]methanamine?
The canonical SMILES for [6-(2-methyl-1,3-oxazol-5-yl)pyrimidin-4-yl]methanamine is Cc1ncc(-c2cc(CN)ncn2)o1.
What is the InChIKey of [6-(2-methyl-1,3-oxazol-5-yl)pyrimidin-4-yl]methanamine?
The InChIKey is FFCKICBXUPJHNT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N4O/c1-6-11-4-9(14-6)8-2-7(3-10)12-5-13-8/h2,4-5H,3,10H2,1H3.
What are the key properties of [6-(2-methyl-1,3-oxazol-5-yl)pyrimidin-4-yl]methanamine?
[6-(2-methyl-1,3-oxazol-5-yl)pyrimidin-4-yl]methanamine has a molecular weight of 190.21 g/mol, XLogP of 0.90, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [6-(2-methyl-1,3-oxazol-5-yl)pyrimidin-4-yl]methanamine is sourced from PubChem (CID 82404090), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).