About 7-hydroxy-2,3-dimethyl-1-benzofuran-4-carbaldehyde
7-hydroxy-2,3-dimethyl-1-benzofuran-4-carbaldehyde (PubChem CID 82404202) has the molecular formula C11H10O3
and a molecular weight of 190.20 g/mol. Its IUPAC name is 7-hydroxy-2,3-dimethyl-1-benzofuran-4-carbaldehyde.
Molecular Properties
| Compound Name | 7-hydroxy-2,3-dimethyl-1-benzofuran-4-carbaldehyde |
| PubChem CID | 82404202 |
| Molecular Formula | C11H10O3 |
| Molecular Weight | 190.20 g/mol |
| Exact Mass | 190.06 |
| IUPAC Name | 7-hydroxy-2,3-dimethyl-1-benzofuran-4-carbaldehyde |
| SMILES | Cc1oc2c(O)ccc(C=O)c2c1C |
| InChI | InChI=1S/C11H10O3/c1-6-7(2)14-11-9(13)4-3-8(5-12)10(6)11/h3-5,13H,1-2H3 |
| InChIKey | DPTGHFZACIWJMV-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 50.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.20 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 7-hydroxy-2,3-dimethyl-1-benzofuran-4-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-hydroxy-2,3-dimethyl-1-benzofuran-4-carbaldehyde?
The IUPAC name of 7-hydroxy-2,3-dimethyl-1-benzofuran-4-carbaldehyde (CID 82404202) is 7-hydroxy-2,3-dimethyl-1-benzofuran-4-carbaldehyde.
What is the SMILES notation for 7-hydroxy-2,3-dimethyl-1-benzofuran-4-carbaldehyde?
The canonical SMILES for 7-hydroxy-2,3-dimethyl-1-benzofuran-4-carbaldehyde is Cc1oc2c(O)ccc(C=O)c2c1C.
What is the InChIKey of 7-hydroxy-2,3-dimethyl-1-benzofuran-4-carbaldehyde?
The InChIKey is DPTGHFZACIWJMV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10O3/c1-6-7(2)14-11-9(13)4-3-8(5-12)10(6)11/h3-5,13H,1-2H3.
What are the key properties of 7-hydroxy-2,3-dimethyl-1-benzofuran-4-carbaldehyde?
7-hydroxy-2,3-dimethyl-1-benzofuran-4-carbaldehyde has a molecular weight of 190.20 g/mol, XLogP of 2.57, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-hydroxy-2,3-dimethyl-1-benzofuran-4-carbaldehyde is sourced from PubChem (CID 82404202), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).