About 1-(1-methylindol-7-yl)ethane-1,2-diamine
1-(1-methylindol-7-yl)ethane-1,2-diamine (PubChem CID 82404349) has the molecular formula C11H15N3
and a molecular weight of 189.26 g/mol. Its IUPAC name is 1-(1-methylindol-7-yl)ethane-1,2-diamine.
Molecular Properties
| Compound Name | 1-(1-methylindol-7-yl)ethane-1,2-diamine |
| PubChem CID | 82404349 |
| Molecular Formula | C11H15N3 |
| Molecular Weight | 189.26 g/mol |
| Exact Mass | 189.13 |
| IUPAC Name | 1-(1-methylindol-7-yl)ethane-1,2-diamine |
| SMILES | Cn1ccc2cccc(C(N)CN)c21 |
| InChI | InChI=1S/C11H15N3/c1-14-6-5-8-3-2-4-9(11(8)14)10(13)7-12/h2-6,10H,7,12-13H2,1H3 |
| InChIKey | UXXSIBQZPBBYQR-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 56.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.26 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(1-methylindol-7-yl)ethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1-methylindol-7-yl)ethane-1,2-diamine?
The IUPAC name of 1-(1-methylindol-7-yl)ethane-1,2-diamine (CID 82404349) is 1-(1-methylindol-7-yl)ethane-1,2-diamine.
What is the SMILES notation for 1-(1-methylindol-7-yl)ethane-1,2-diamine?
The canonical SMILES for 1-(1-methylindol-7-yl)ethane-1,2-diamine is Cn1ccc2cccc(C(N)CN)c21.
What is the InChIKey of 1-(1-methylindol-7-yl)ethane-1,2-diamine?
The InChIKey is UXXSIBQZPBBYQR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15N3/c1-14-6-5-8-3-2-4-9(11(8)14)10(13)7-12/h2-6,10H,7,12-13H2,1H3.
What are the key properties of 1-(1-methylindol-7-yl)ethane-1,2-diamine?
1-(1-methylindol-7-yl)ethane-1,2-diamine has a molecular weight of 189.26 g/mol, XLogP of 1.14, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1-methylindol-7-yl)ethane-1,2-diamine is sourced from PubChem (CID 82404349), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).