About 7-propan-2-ylfuro[3,2-c]pyridine-2-carbaldehyde
7-propan-2-ylfuro[3,2-c]pyridine-2-carbaldehyde (PubChem CID 82404749) has the molecular formula C11H11NO2
and a molecular weight of 189.21 g/mol. Its IUPAC name is 7-propan-2-ylfuro[3,2-c]pyridine-2-carbaldehyde.
Molecular Properties
| Compound Name | 7-propan-2-ylfuro[3,2-c]pyridine-2-carbaldehyde |
| PubChem CID | 82404749 |
| Molecular Formula | C11H11NO2 |
| Molecular Weight | 189.21 g/mol |
| Exact Mass | 189.08 |
| IUPAC Name | 7-propan-2-ylfuro[3,2-c]pyridine-2-carbaldehyde |
| SMILES | CC(C)c1cncc2cc(C=O)oc12 |
| InChI | InChI=1S/C11H11NO2/c1-7(2)10-5-12-4-8-3-9(6-13)14-11(8)10/h3-7H,1-2H3 |
| InChIKey | QZXLUSNDFNWNMI-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.21 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 7-propan-2-ylfuro[3,2-c]pyridine-2-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-propan-2-ylfuro[3,2-c]pyridine-2-carbaldehyde?
The IUPAC name of 7-propan-2-ylfuro[3,2-c]pyridine-2-carbaldehyde (CID 82404749) is 7-propan-2-ylfuro[3,2-c]pyridine-2-carbaldehyde.
What is the SMILES notation for 7-propan-2-ylfuro[3,2-c]pyridine-2-carbaldehyde?
The canonical SMILES for 7-propan-2-ylfuro[3,2-c]pyridine-2-carbaldehyde is CC(C)c1cncc2cc(C=O)oc12.
What is the InChIKey of 7-propan-2-ylfuro[3,2-c]pyridine-2-carbaldehyde?
The InChIKey is QZXLUSNDFNWNMI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11NO2/c1-7(2)10-5-12-4-8-3-9(6-13)14-11(8)10/h3-7H,1-2H3.
What are the key properties of 7-propan-2-ylfuro[3,2-c]pyridine-2-carbaldehyde?
7-propan-2-ylfuro[3,2-c]pyridine-2-carbaldehyde has a molecular weight of 189.21 g/mol, XLogP of 2.76, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-propan-2-ylfuro[3,2-c]pyridine-2-carbaldehyde is sourced from PubChem (CID 82404749), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).