C8H20N4O — CID 82404869
1-(2-aminopropyl)-1-[2-(dimethylamino)ethyl]urea (PubChem CID 82404869) has the molecular formula C8H20N4O and a molecular weight of 188.27 g/mol. Its IUPAC name is 1-(2-aminopropyl)-1-[2-(dimethylamino)ethyl]urea.
| Compound Name | 1-(2-aminopropyl)-1-[2-(dimethylamino)ethyl]urea |
|---|---|
| PubChem CID | 82404869 |
| Molecular Formula | C8H20N4O |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.16 |
| IUPAC Name | 1-(2-aminopropyl)-1-[2-(dimethylamino)ethyl]urea |
| SMILES | CC(N)CN(CCN(C)C)C(N)=O |
| InChI | InChI=1S/C8H20N4O/c1-7(9)6-12(8(10)13)5-4-11(2)3/h7H,4-6,9H2,1-3H3,(H2,10,13) |
| InChIKey | ZQRXRBQYJMVUJL-UHFFFAOYSA-N |
| XLogP | -0.72 |
| TPSA | 75.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |