About (1-imidazo[1,2-a]pyrazin-3-ylcyclopropyl)methanamine
(1-imidazo[1,2-a]pyrazin-3-ylcyclopropyl)methanamine (PubChem CID 82404960) has the molecular formula C10H12N4
and a molecular weight of 188.23 g/mol. Its IUPAC name is (1-imidazo[1,2-a]pyrazin-3-ylcyclopropyl)methanamine.
Molecular Properties
| Compound Name | (1-imidazo[1,2-a]pyrazin-3-ylcyclopropyl)methanamine |
| PubChem CID | 82404960 |
| Molecular Formula | C10H12N4 |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.11 |
| IUPAC Name | (1-imidazo[1,2-a]pyrazin-3-ylcyclopropyl)methanamine |
| SMILES | NCC1(c2cnc3cnccn23)CC1 |
| InChI | InChI=1S/C10H12N4/c11-7-10(1-2-10)8-5-13-9-6-12-3-4-14(8)9/h3-6H,1-2,7,11H2 |
| InChIKey | DMYVSEATEUPFAM-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 56.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (1-imidazo[1,2-a]pyrazin-3-ylcyclopropyl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-imidazo[1,2-a]pyrazin-3-ylcyclopropyl)methanamine?
The IUPAC name of (1-imidazo[1,2-a]pyrazin-3-ylcyclopropyl)methanamine (CID 82404960) is (1-imidazo[1,2-a]pyrazin-3-ylcyclopropyl)methanamine.
What is the SMILES notation for (1-imidazo[1,2-a]pyrazin-3-ylcyclopropyl)methanamine?
The canonical SMILES for (1-imidazo[1,2-a]pyrazin-3-ylcyclopropyl)methanamine is NCC1(c2cnc3cnccn23)CC1.
What is the InChIKey of (1-imidazo[1,2-a]pyrazin-3-ylcyclopropyl)methanamine?
The InChIKey is DMYVSEATEUPFAM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N4/c11-7-10(1-2-10)8-5-13-9-6-12-3-4-14(8)9/h3-6H,1-2,7,11H2.
What are the key properties of (1-imidazo[1,2-a]pyrazin-3-ylcyclopropyl)methanamine?
(1-imidazo[1,2-a]pyrazin-3-ylcyclopropyl)methanamine has a molecular weight of 188.23 g/mol, XLogP of 0.72, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (1-imidazo[1,2-a]pyrazin-3-ylcyclopropyl)methanamine is sourced from PubChem (CID 82404960), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).