About 5-pyrrolidin-3-yl-2,1-benzoxazole
5-pyrrolidin-3-yl-2,1-benzoxazole (PubChem CID 82405036) has the molecular formula C11H12N2O
and a molecular weight of 188.23 g/mol. Its IUPAC name is 5-pyrrolidin-3-yl-2,1-benzoxazole.
Molecular Properties
| Compound Name | 5-pyrrolidin-3-yl-2,1-benzoxazole |
| PubChem CID | 82405036 |
| Molecular Formula | C11H12N2O |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.09 |
| IUPAC Name | 5-pyrrolidin-3-yl-2,1-benzoxazole |
| SMILES | c1cc2nocc2cc1C1CCNC1 |
| InChI | InChI=1S/C11H12N2O/c1-2-11-10(7-14-13-11)5-8(1)9-3-4-12-6-9/h1-2,5,7,9,12H,3-4,6H2 |
| InChIKey | ICOUIAJZCOLIJK-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-pyrrolidin-3-yl-2,1-benzoxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-pyrrolidin-3-yl-2,1-benzoxazole?
The IUPAC name of 5-pyrrolidin-3-yl-2,1-benzoxazole (CID 82405036) is 5-pyrrolidin-3-yl-2,1-benzoxazole.
What is the SMILES notation for 5-pyrrolidin-3-yl-2,1-benzoxazole?
The canonical SMILES for 5-pyrrolidin-3-yl-2,1-benzoxazole is c1cc2nocc2cc1C1CCNC1.
What is the InChIKey of 5-pyrrolidin-3-yl-2,1-benzoxazole?
The InChIKey is ICOUIAJZCOLIJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N2O/c1-2-11-10(7-14-13-11)5-8(1)9-3-4-12-6-9/h1-2,5,7,9,12H,3-4,6H2.
What are the key properties of 5-pyrrolidin-3-yl-2,1-benzoxazole?
5-pyrrolidin-3-yl-2,1-benzoxazole has a molecular weight of 188.23 g/mol, XLogP of 1.90, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-pyrrolidin-3-yl-2,1-benzoxazole is sourced from PubChem (CID 82405036), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).