C11H12N2O — CID 82405036
5-pyrrolidin-3-yl-2,1-benzoxazole (PubChem CID 82405036) has the molecular formula C11H12N2O and a molecular weight of 188.23 g/mol. Its IUPAC name is 5-pyrrolidin-3-yl-2,1-benzoxazole.
| Compound Name | 5-pyrrolidin-3-yl-2,1-benzoxazole |
|---|---|
| PubChem CID | 82405036 |
| Molecular Formula | C11H12N2O |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.09 |
| IUPAC Name | 5-pyrrolidin-3-yl-2,1-benzoxazole |
| SMILES | c1cc2nocc2cc1C1CCNC1 |
| InChI | InChI=1S/C11H12N2O/c1-2-11-10(7-14-13-11)5-8(1)9-3-4-12-6-9/h1-2,5,7,9,12H,3-4,6H2 |
| InChIKey | ICOUIAJZCOLIJK-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |