About 2-(6,7-dimethyl-1H-indol-3-yl)acetaldehyde
2-(6,7-dimethyl-1H-indol-3-yl)acetaldehyde (PubChem CID 82405431) has the molecular formula C12H13NO
and a molecular weight of 187.24 g/mol. Its IUPAC name is 2-(6,7-dimethyl-1H-indol-3-yl)acetaldehyde.
Molecular Properties
| Compound Name | 2-(6,7-dimethyl-1H-indol-3-yl)acetaldehyde |
| PubChem CID | 82405431 |
| Molecular Formula | C12H13NO |
| Molecular Weight | 187.24 g/mol |
| Exact Mass | 187.10 |
| IUPAC Name | 2-(6,7-dimethyl-1H-indol-3-yl)acetaldehyde |
| SMILES | Cc1ccc2c(CC=O)c[nH]c2c1C |
| InChI | InChI=1S/C12H13NO/c1-8-3-4-11-10(5-6-14)7-13-12(11)9(8)2/h3-4,6-7,13H,5H2,1-2H3 |
| InChIKey | BXCQHPYMRNRMDA-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.24 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-(6,7-dimethyl-1H-indol-3-yl)acetaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(6,7-dimethyl-1H-indol-3-yl)acetaldehyde?
The IUPAC name of 2-(6,7-dimethyl-1H-indol-3-yl)acetaldehyde (CID 82405431) is 2-(6,7-dimethyl-1H-indol-3-yl)acetaldehyde.
What is the SMILES notation for 2-(6,7-dimethyl-1H-indol-3-yl)acetaldehyde?
The canonical SMILES for 2-(6,7-dimethyl-1H-indol-3-yl)acetaldehyde is Cc1ccc2c(CC=O)c[nH]c2c1C.
What is the InChIKey of 2-(6,7-dimethyl-1H-indol-3-yl)acetaldehyde?
The InChIKey is BXCQHPYMRNRMDA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13NO/c1-8-3-4-11-10(5-6-14)7-13-12(11)9(8)2/h3-4,6-7,13H,5H2,1-2H3.
What are the key properties of 2-(6,7-dimethyl-1H-indol-3-yl)acetaldehyde?
2-(6,7-dimethyl-1H-indol-3-yl)acetaldehyde has a molecular weight of 187.24 g/mol, XLogP of 2.53, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(6,7-dimethyl-1H-indol-3-yl)acetaldehyde is sourced from PubChem (CID 82405431), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).