2-methyl-2-(3-methyl-1,2-thiazol-5-yl)propanoic acid

C8H11NO2S — CID 82406156

IUPAC2-methyl-2-(3-methyl-1,2-thiazol-5-yl)propanoic acid
SMILESCc1cc(C(C)(C)C(=O)O)sn1
InChIInChI=1S/C8H11NO2S/c1-5-4-6(12-9-5)8(2,3)7(10)11/h4H,1-3H3,(H,10,11)
InChIKeyUXQHHDWZNSNVML-UHFFFAOYSA-N
MW185.25 g/mol
LogP1.81
Rot. Bonds2

About 2-methyl-2-(3-methyl-1,2-thiazol-5-yl)propanoic acid

2-methyl-2-(3-methyl-1,2-thiazol-5-yl)propanoic acid (PubChem CID 82406156) has the molecular formula C8H11NO2S and a molecular weight of 185.25 g/mol. Its IUPAC name is 2-methyl-2-(3-methyl-1,2-thiazol-5-yl)propanoic acid.

Molecular Properties

Compound Name2-methyl-2-(3-methyl-1,2-thiazol-5-yl)propanoic acid
PubChem CID82406156
Molecular FormulaC8H11NO2S
Molecular Weight185.25 g/mol
Exact Mass185.05
IUPAC Name2-methyl-2-(3-methyl-1,2-thiazol-5-yl)propanoic acid
SMILESCc1cc(C(C)(C)C(=O)O)sn1
InChIInChI=1S/C8H11NO2S/c1-5-4-6(12-9-5)8(2,3)7(10)11/h4H,1-3H3,(H,10,11)
InChIKeyUXQHHDWZNSNVML-UHFFFAOYSA-N
XLogP1.81
TPSA50.19 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500185.25
LogP ≤ 51.81
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2-methyl-2-(3-methyl-1,2-thiazol-5-yl)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-methyl-2-(3-methyl-1,2-thiazol-5-yl)propanoic acid?
The IUPAC name of 2-methyl-2-(3-methyl-1,2-thiazol-5-yl)propanoic acid (CID 82406156) is 2-methyl-2-(3-methyl-1,2-thiazol-5-yl)propanoic acid.
What is the SMILES notation for 2-methyl-2-(3-methyl-1,2-thiazol-5-yl)propanoic acid?
The canonical SMILES for 2-methyl-2-(3-methyl-1,2-thiazol-5-yl)propanoic acid is Cc1cc(C(C)(C)C(=O)O)sn1.
What is the InChIKey of 2-methyl-2-(3-methyl-1,2-thiazol-5-yl)propanoic acid?
The InChIKey is UXQHHDWZNSNVML-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11NO2S/c1-5-4-6(12-9-5)8(2,3)7(10)11/h4H,1-3H3,(H,10,11).
What are the key properties of 2-methyl-2-(3-methyl-1,2-thiazol-5-yl)propanoic acid?
2-methyl-2-(3-methyl-1,2-thiazol-5-yl)propanoic acid has a molecular weight of 185.25 g/mol, XLogP of 1.81, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-2-(3-methyl-1,2-thiazol-5-yl)propanoic acid is sourced from PubChem (CID 82406156), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).