About 2-(6,7-dihydro-4H-thieno[3,2-c]pyran-2-yl)ethanamine
2-(6,7-dihydro-4H-thieno[3,2-c]pyran-2-yl)ethanamine (PubChem CID 82406992) has the molecular formula C9H13NOS
and a molecular weight of 183.28 g/mol. Its IUPAC name is 2-(6,7-dihydro-4H-thieno[3,2-c]pyran-2-yl)ethanamine.
Molecular Properties
| Compound Name | 2-(6,7-dihydro-4H-thieno[3,2-c]pyran-2-yl)ethanamine |
| PubChem CID | 82406992 |
| Molecular Formula | C9H13NOS |
| Molecular Weight | 183.28 g/mol |
| Exact Mass | 183.07 |
| IUPAC Name | 2-(6,7-dihydro-4H-thieno[3,2-c]pyran-2-yl)ethanamine |
| SMILES | NCCc1cc2c(s1)CCOC2 |
| InChI | InChI=1S/C9H13NOS/c10-3-1-8-5-7-6-11-4-2-9(7)12-8/h5H,1-4,6,10H2 |
| InChIKey | KKMKSSLTMKZCJB-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.28 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(6,7-dihydro-4H-thieno[3,2-c]pyran-2-yl)ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(6,7-dihydro-4H-thieno[3,2-c]pyran-2-yl)ethanamine?
The IUPAC name of 2-(6,7-dihydro-4H-thieno[3,2-c]pyran-2-yl)ethanamine (CID 82406992) is 2-(6,7-dihydro-4H-thieno[3,2-c]pyran-2-yl)ethanamine.
What is the SMILES notation for 2-(6,7-dihydro-4H-thieno[3,2-c]pyran-2-yl)ethanamine?
The canonical SMILES for 2-(6,7-dihydro-4H-thieno[3,2-c]pyran-2-yl)ethanamine is NCCc1cc2c(s1)CCOC2.
What is the InChIKey of 2-(6,7-dihydro-4H-thieno[3,2-c]pyran-2-yl)ethanamine?
The InChIKey is KKMKSSLTMKZCJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13NOS/c10-3-1-8-5-7-6-11-4-2-9(7)12-8/h5H,1-4,6,10H2.
What are the key properties of 2-(6,7-dihydro-4H-thieno[3,2-c]pyran-2-yl)ethanamine?
2-(6,7-dihydro-4H-thieno[3,2-c]pyran-2-yl)ethanamine has a molecular weight of 183.28 g/mol, XLogP of 1.32, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(6,7-dihydro-4H-thieno[3,2-c]pyran-2-yl)ethanamine is sourced from PubChem (CID 82406992), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).