About 1-amino-3-(1,3,5-trimethylpyrazol-4-yl)propan-2-ol
1-amino-3-(1,3,5-trimethylpyrazol-4-yl)propan-2-ol (PubChem CID 82407064) has the molecular formula C9H17N3O
and a molecular weight of 183.25 g/mol. Its IUPAC name is 1-amino-3-(1,3,5-trimethylpyrazol-4-yl)propan-2-ol.
Molecular Properties
| Compound Name | 1-amino-3-(1,3,5-trimethylpyrazol-4-yl)propan-2-ol |
| PubChem CID | 82407064 |
| Molecular Formula | C9H17N3O |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.14 |
| IUPAC Name | 1-amino-3-(1,3,5-trimethylpyrazol-4-yl)propan-2-ol |
| SMILES | Cc1nn(C)c(C)c1CC(O)CN |
| InChI | InChI=1S/C9H17N3O/c1-6-9(4-8(13)5-10)7(2)12(3)11-6/h8,13H,4-5,10H2,1-3H3 |
| InChIKey | MVTVARNBZFTLSW-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-amino-3-(1,3,5-trimethylpyrazol-4-yl)propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-amino-3-(1,3,5-trimethylpyrazol-4-yl)propan-2-ol?
The IUPAC name of 1-amino-3-(1,3,5-trimethylpyrazol-4-yl)propan-2-ol (CID 82407064) is 1-amino-3-(1,3,5-trimethylpyrazol-4-yl)propan-2-ol.
What is the SMILES notation for 1-amino-3-(1,3,5-trimethylpyrazol-4-yl)propan-2-ol?
The canonical SMILES for 1-amino-3-(1,3,5-trimethylpyrazol-4-yl)propan-2-ol is Cc1nn(C)c(C)c1CC(O)CN.
What is the InChIKey of 1-amino-3-(1,3,5-trimethylpyrazol-4-yl)propan-2-ol?
The InChIKey is MVTVARNBZFTLSW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17N3O/c1-6-9(4-8(13)5-10)7(2)12(3)11-6/h8,13H,4-5,10H2,1-3H3.
What are the key properties of 1-amino-3-(1,3,5-trimethylpyrazol-4-yl)propan-2-ol?
1-amino-3-(1,3,5-trimethylpyrazol-4-yl)propan-2-ol has a molecular weight of 183.25 g/mol, XLogP of -0.10, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-amino-3-(1,3,5-trimethylpyrazol-4-yl)propan-2-ol is sourced from PubChem (CID 82407064), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).