2-furo[2,3-d][1,2]thiazol-3-ylacetic acid

C7H5NO3S — CID 82407349

IUPAC2-furo[2,3-d][1,2]thiazol-3-ylacetic acid
SMILESO=C(O)Cc1nsc2ccoc12
InChIInChI=1S/C7H5NO3S/c9-6(10)3-4-7-5(12-8-4)1-2-11-7/h1-2H,3H2,(H,9,10)
InChIKeyKDEHFZNCAWEOLZ-UHFFFAOYSA-N
MW183.19 g/mol
LogP1.52
Rot. Bonds2

About 2-furo[2,3-d][1,2]thiazol-3-ylacetic acid

2-furo[2,3-d][1,2]thiazol-3-ylacetic acid (PubChem CID 82407349) has the molecular formula C7H5NO3S and a molecular weight of 183.19 g/mol. Its IUPAC name is 2-furo[2,3-d][1,2]thiazol-3-ylacetic acid.

Molecular Properties

Compound Name2-furo[2,3-d][1,2]thiazol-3-ylacetic acid
PubChem CID82407349
Molecular FormulaC7H5NO3S
Molecular Weight183.19 g/mol
Exact Mass183.00
IUPAC Name2-furo[2,3-d][1,2]thiazol-3-ylacetic acid
SMILESO=C(O)Cc1nsc2ccoc12
InChIInChI=1S/C7H5NO3S/c9-6(10)3-4-7-5(12-8-4)1-2-11-7/h1-2H,3H2,(H,9,10)
InChIKeyKDEHFZNCAWEOLZ-UHFFFAOYSA-N
XLogP1.52
TPSA63.33 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500183.19
LogP ≤ 51.52
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 2-furo[2,3-d][1,2]thiazol-3-ylacetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-furo[2,3-d][1,2]thiazol-3-ylacetic acid?
The IUPAC name of 2-furo[2,3-d][1,2]thiazol-3-ylacetic acid (CID 82407349) is 2-furo[2,3-d][1,2]thiazol-3-ylacetic acid.
What is the SMILES notation for 2-furo[2,3-d][1,2]thiazol-3-ylacetic acid?
The canonical SMILES for 2-furo[2,3-d][1,2]thiazol-3-ylacetic acid is O=C(O)Cc1nsc2ccoc12.
What is the InChIKey of 2-furo[2,3-d][1,2]thiazol-3-ylacetic acid?
The InChIKey is KDEHFZNCAWEOLZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5NO3S/c9-6(10)3-4-7-5(12-8-4)1-2-11-7/h1-2H,3H2,(H,9,10).
What are the key properties of 2-furo[2,3-d][1,2]thiazol-3-ylacetic acid?
2-furo[2,3-d][1,2]thiazol-3-ylacetic acid has a molecular weight of 183.19 g/mol, XLogP of 1.52, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-furo[2,3-d][1,2]thiazol-3-ylacetic acid is sourced from PubChem (CID 82407349), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).