C10H18N2O — CID 82407628
2-methyl-2,8-diazaspiro[5.5]undecan-11-one (PubChem CID 82407628) has the molecular formula C10H18N2O and a molecular weight of 182.27 g/mol. Its IUPAC name is 2-methyl-2,8-diazaspiro[5.5]undecan-11-one.
| Compound Name | 2-methyl-2,8-diazaspiro[5.5]undecan-11-one |
|---|---|
| PubChem CID | 82407628 |
| Molecular Formula | C10H18N2O |
| Molecular Weight | 182.27 g/mol |
| Exact Mass | 182.14 |
| IUPAC Name | 2-methyl-2,8-diazaspiro[5.5]undecan-11-one |
| SMILES | CN1CCCC2(CNCCC2=O)C1 |
| InChI | InChI=1S/C10H18N2O/c1-12-6-2-4-10(8-12)7-11-5-3-9(10)13/h11H,2-8H2,1H3 |
| InChIKey | HBSLHOZKHYSOAQ-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.27 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |