About [2-(5-methyl-1,2-oxazol-3-yl)pyrrolidin-3-yl]methanamine
[2-(5-methyl-1,2-oxazol-3-yl)pyrrolidin-3-yl]methanamine (PubChem CID 82408303) has the molecular formula C9H15N3O
and a molecular weight of 181.24 g/mol. Its IUPAC name is [2-(5-methyl-1,2-oxazol-3-yl)pyrrolidin-3-yl]methanamine.
Molecular Properties
| Compound Name | [2-(5-methyl-1,2-oxazol-3-yl)pyrrolidin-3-yl]methanamine |
| PubChem CID | 82408303 |
| Molecular Formula | C9H15N3O |
| Molecular Weight | 181.24 g/mol |
| Exact Mass | 181.12 |
| IUPAC Name | [2-(5-methyl-1,2-oxazol-3-yl)pyrrolidin-3-yl]methanamine |
| SMILES | Cc1cc(C2NCCC2CN)no1 |
| InChI | InChI=1S/C9H15N3O/c1-6-4-8(12-13-6)9-7(5-10)2-3-11-9/h4,7,9,11H,2-3,5,10H2,1H3 |
| InChIKey | RCWNTBJHYHAVLA-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 64.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.24 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [2-(5-methyl-1,2-oxazol-3-yl)pyrrolidin-3-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(5-methyl-1,2-oxazol-3-yl)pyrrolidin-3-yl]methanamine?
The IUPAC name of [2-(5-methyl-1,2-oxazol-3-yl)pyrrolidin-3-yl]methanamine (CID 82408303) is [2-(5-methyl-1,2-oxazol-3-yl)pyrrolidin-3-yl]methanamine.
What is the SMILES notation for [2-(5-methyl-1,2-oxazol-3-yl)pyrrolidin-3-yl]methanamine?
The canonical SMILES for [2-(5-methyl-1,2-oxazol-3-yl)pyrrolidin-3-yl]methanamine is Cc1cc(C2NCCC2CN)no1.
What is the InChIKey of [2-(5-methyl-1,2-oxazol-3-yl)pyrrolidin-3-yl]methanamine?
The InChIKey is RCWNTBJHYHAVLA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15N3O/c1-6-4-8(12-13-6)9-7(5-10)2-3-11-9/h4,7,9,11H,2-3,5,10H2,1H3.
What are the key properties of [2-(5-methyl-1,2-oxazol-3-yl)pyrrolidin-3-yl]methanamine?
[2-(5-methyl-1,2-oxazol-3-yl)pyrrolidin-3-yl]methanamine has a molecular weight of 181.24 g/mol, XLogP of 0.59, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(5-methyl-1,2-oxazol-3-yl)pyrrolidin-3-yl]methanamine is sourced from PubChem (CID 82408303), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).