About 5-amino-2-(5-methyl-1,3-oxazol-2-yl)-4H-pyrazol-3-one
5-amino-2-(5-methyl-1,3-oxazol-2-yl)-4H-pyrazol-3-one (PubChem CID 82409209) has the molecular formula C7H8N4O2
and a molecular weight of 180.17 g/mol. Its IUPAC name is 5-amino-2-(5-methyl-1,3-oxazol-2-yl)-4H-pyrazol-3-one.
Molecular Properties
| Compound Name | 5-amino-2-(5-methyl-1,3-oxazol-2-yl)-4H-pyrazol-3-one |
| PubChem CID | 82409209 |
| Molecular Formula | C7H8N4O2 |
| Molecular Weight | 180.17 g/mol |
| Exact Mass | 180.06 |
| IUPAC Name | 5-amino-2-(5-methyl-1,3-oxazol-2-yl)-4H-pyrazol-3-one |
| SMILES | Cc1cnc(N2N=C(N)CC2=O)o1 |
| InChI | InChI=1S/C7H8N4O2/c1-4-3-9-7(13-4)11-6(12)2-5(8)10-11/h3H,2H2,1H3,(H2,8,10) |
| InChIKey | VWLVDVMIWXSIMV-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 84.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.17 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-amino-2-(5-methyl-1,3-oxazol-2-yl)-4H-pyrazol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-2-(5-methyl-1,3-oxazol-2-yl)-4H-pyrazol-3-one?
The IUPAC name of 5-amino-2-(5-methyl-1,3-oxazol-2-yl)-4H-pyrazol-3-one (CID 82409209) is 5-amino-2-(5-methyl-1,3-oxazol-2-yl)-4H-pyrazol-3-one.
What is the SMILES notation for 5-amino-2-(5-methyl-1,3-oxazol-2-yl)-4H-pyrazol-3-one?
The canonical SMILES for 5-amino-2-(5-methyl-1,3-oxazol-2-yl)-4H-pyrazol-3-one is Cc1cnc(N2N=C(N)CC2=O)o1.
What is the InChIKey of 5-amino-2-(5-methyl-1,3-oxazol-2-yl)-4H-pyrazol-3-one?
The InChIKey is VWLVDVMIWXSIMV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N4O2/c1-4-3-9-7(13-4)11-6(12)2-5(8)10-11/h3H,2H2,1H3,(H2,8,10).
What are the key properties of 5-amino-2-(5-methyl-1,3-oxazol-2-yl)-4H-pyrazol-3-one?
5-amino-2-(5-methyl-1,3-oxazol-2-yl)-4H-pyrazol-3-one has a molecular weight of 180.17 g/mol, XLogP of -0.01, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-2-(5-methyl-1,3-oxazol-2-yl)-4H-pyrazol-3-one is sourced from PubChem (CID 82409209), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).