7-amino-[1,2]oxazolo[4,5-d]pyrimidine-3-carboxylic acid

C6H4N4O3 — CID 82409267

IUPAC7-amino-[1,2]oxazolo[4,5-d]pyrimidine-3-carboxylic acid
SMILESNc1ncnc2c(C(=O)O)noc12
InChIInChI=1S/C6H4N4O3/c7-5-4-2(8-1-9-5)3(6(11)12)10-13-4/h1H,(H,11,12)(H2,7,8,9)
InChIKeyJAGSDKIPLAJOBG-UHFFFAOYSA-N
MW180.12 g/mol
LogP-0.10
Rot. Bonds1

About 7-amino-[1,2]oxazolo[4,5-d]pyrimidine-3-carboxylic acid

7-amino-[1,2]oxazolo[4,5-d]pyrimidine-3-carboxylic acid (PubChem CID 82409267) has the molecular formula C6H4N4O3 and a molecular weight of 180.12 g/mol. Its IUPAC name is 7-amino-[1,2]oxazolo[4,5-d]pyrimidine-3-carboxylic acid.

Molecular Properties

Compound Name7-amino-[1,2]oxazolo[4,5-d]pyrimidine-3-carboxylic acid
PubChem CID82409267
Molecular FormulaC6H4N4O3
Molecular Weight180.12 g/mol
Exact Mass180.03
IUPAC Name7-amino-[1,2]oxazolo[4,5-d]pyrimidine-3-carboxylic acid
SMILESNc1ncnc2c(C(=O)O)noc12
InChIInChI=1S/C6H4N4O3/c7-5-4-2(8-1-9-5)3(6(11)12)10-13-4/h1H,(H,11,12)(H2,7,8,9)
InChIKeyJAGSDKIPLAJOBG-UHFFFAOYSA-N
XLogP-0.10
TPSA115.13 Ų
H-Bond Donors2
H-Bond Acceptors6
Rotatable Bonds1
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500180.12
LogP ≤ 5-0.10
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 106

Analyze 7-amino-[1,2]oxazolo[4,5-d]pyrimidine-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 7-amino-[1,2]oxazolo[4,5-d]pyrimidine-3-carboxylic acid?
The IUPAC name of 7-amino-[1,2]oxazolo[4,5-d]pyrimidine-3-carboxylic acid (CID 82409267) is 7-amino-[1,2]oxazolo[4,5-d]pyrimidine-3-carboxylic acid.
What is the SMILES notation for 7-amino-[1,2]oxazolo[4,5-d]pyrimidine-3-carboxylic acid?
The canonical SMILES for 7-amino-[1,2]oxazolo[4,5-d]pyrimidine-3-carboxylic acid is Nc1ncnc2c(C(=O)O)noc12.
What is the InChIKey of 7-amino-[1,2]oxazolo[4,5-d]pyrimidine-3-carboxylic acid?
The InChIKey is JAGSDKIPLAJOBG-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4N4O3/c7-5-4-2(8-1-9-5)3(6(11)12)10-13-4/h1H,(H,11,12)(H2,7,8,9).
What are the key properties of 7-amino-[1,2]oxazolo[4,5-d]pyrimidine-3-carboxylic acid?
7-amino-[1,2]oxazolo[4,5-d]pyrimidine-3-carboxylic acid has a molecular weight of 180.12 g/mol, XLogP of -0.10, 1 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 7-amino-[1,2]oxazolo[4,5-d]pyrimidine-3-carboxylic acid is sourced from PubChem (CID 82409267), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).