About (1S)-1-([1,3]thiazolo[5,4-b]pyridin-2-yl)ethanamine
(1S)-1-([1,3]thiazolo[5,4-b]pyridin-2-yl)ethanamine (PubChem CID 82409431) has the molecular formula C8H9N3S
and a molecular weight of 179.25 g/mol. Its IUPAC name is (1S)-1-([1,3]thiazolo[5,4-b]pyridin-2-yl)ethanamine.
Molecular Properties
| Compound Name | (1S)-1-([1,3]thiazolo[5,4-b]pyridin-2-yl)ethanamine |
| PubChem CID | 82409431 |
| Molecular Formula | C8H9N3S |
| Molecular Weight | 179.25 g/mol |
| Exact Mass | 179.05 |
| IUPAC Name | (1S)-1-([1,3]thiazolo[5,4-b]pyridin-2-yl)ethanamine |
| SMILES | C[C@H](N)c1nc2cccnc2s1 |
| InChI | InChI=1S/C8H9N3S/c1-5(9)7-11-6-3-2-4-10-8(6)12-7/h2-5H,9H2,1H3/t5-/m0/s1 |
| InChIKey | AHEZAZDSADODEG-YFKPBYRVSA-N |
| XLogP | 1.71 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.25 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (1S)-1-([1,3]thiazolo[5,4-b]pyridin-2-yl)ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S)-1-([1,3]thiazolo[5,4-b]pyridin-2-yl)ethanamine?
The IUPAC name of (1S)-1-([1,3]thiazolo[5,4-b]pyridin-2-yl)ethanamine (CID 82409431) is (1S)-1-([1,3]thiazolo[5,4-b]pyridin-2-yl)ethanamine.
What is the SMILES notation for (1S)-1-([1,3]thiazolo[5,4-b]pyridin-2-yl)ethanamine?
The canonical SMILES for (1S)-1-([1,3]thiazolo[5,4-b]pyridin-2-yl)ethanamine is C[C@H](N)c1nc2cccnc2s1.
What is the InChIKey of (1S)-1-([1,3]thiazolo[5,4-b]pyridin-2-yl)ethanamine?
The InChIKey is AHEZAZDSADODEG-YFKPBYRVSA-N. The full InChI is InChI=1S/C8H9N3S/c1-5(9)7-11-6-3-2-4-10-8(6)12-7/h2-5H,9H2,1H3/t5-/m0/s1.
What are the key properties of (1S)-1-([1,3]thiazolo[5,4-b]pyridin-2-yl)ethanamine?
(1S)-1-([1,3]thiazolo[5,4-b]pyridin-2-yl)ethanamine has a molecular weight of 179.25 g/mol, XLogP of 1.71, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (1S)-1-([1,3]thiazolo[5,4-b]pyridin-2-yl)ethanamine is sourced from PubChem (CID 82409431), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).