C10H10FNO — CID 82409687
8-fluoro-1,2,3,4-tetrahydro-1-benzazepin-5-one (PubChem CID 82409687) has the molecular formula C10H10FNO and a molecular weight of 179.19 g/mol. Its IUPAC name is 8-fluoro-1,2,3,4-tetrahydro-1-benzazepin-5-one.
| Compound Name | 8-fluoro-1,2,3,4-tetrahydro-1-benzazepin-5-one |
|---|---|
| PubChem CID | 82409687 |
| Molecular Formula | C10H10FNO |
| Molecular Weight | 179.19 g/mol |
| Exact Mass | 179.07 |
| IUPAC Name | 8-fluoro-1,2,3,4-tetrahydro-1-benzazepin-5-one |
| SMILES | O=C1CCCNc2cc(F)ccc21 |
| InChI | InChI=1S/C10H10FNO/c11-7-3-4-8-9(6-7)12-5-1-2-10(8)13/h3-4,6,12H,1-2,5H2 |
| InChIKey | ZFTOVPQZGDFJHK-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.19 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |