C8H9N3O2 — CID 82409745
8-oxo-1,2,3,4-tetrahydropyrimido[1,2-c]pyrimidine-9-carbaldehyde (PubChem CID 82409745) has the molecular formula C8H9N3O2 and a molecular weight of 179.18 g/mol. Its IUPAC name is 8-oxo-1,2,3,4-tetrahydropyrimido[1,2-c]pyrimidine-9-carbaldehyde.
| Compound Name | 8-oxo-1,2,3,4-tetrahydropyrimido[1,2-c]pyrimidine-9-carbaldehyde |
|---|---|
| PubChem CID | 82409745 |
| Molecular Formula | C8H9N3O2 |
| Molecular Weight | 179.18 g/mol |
| Exact Mass | 179.07 |
| IUPAC Name | 8-oxo-1,2,3,4-tetrahydropyrimido[1,2-c]pyrimidine-9-carbaldehyde |
| SMILES | O=Cc1c2n(cnc1=O)CCCN2 |
| InChI | InChI=1S/C8H9N3O2/c12-4-6-7-9-2-1-3-11(7)5-10-8(6)13/h4-5,9H,1-3H2 |
| InChIKey | XANHYEPTWHJWGS-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.18 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|