C7H5N3O3 — CID 82409796
6-methyl-1H-pyrrolo[3,4-d]pyrimidine-2,5,7-trione (PubChem CID 82409796) has the molecular formula C7H5N3O3 and a molecular weight of 179.13 g/mol. Its IUPAC name is 6-methyl-1H-pyrrolo[3,4-d]pyrimidine-2,5,7-trione.
| Compound Name | 6-methyl-1H-pyrrolo[3,4-d]pyrimidine-2,5,7-trione |
|---|---|
| PubChem CID | 82409796 |
| Molecular Formula | C7H5N3O3 |
| Molecular Weight | 179.13 g/mol |
| Exact Mass | 179.03 |
| IUPAC Name | 6-methyl-1H-pyrrolo[3,4-d]pyrimidine-2,5,7-trione |
| SMILES | CN1C(=O)c2cnc(=O)[nH]c2C1=O |
| InChI | InChI=1S/C7H5N3O3/c1-10-5(11)3-2-8-7(13)9-4(3)6(10)12/h2H,1H3,(H,8,9,13) |
| InChIKey | HUQJKHYBWZPZHL-UHFFFAOYSA-N |
| XLogP | -1.00 |
| TPSA | 83.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.13 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|