C8H6N2OS — CID 82410051
1-thieno[2,3-b]pyrazin-6-ylethanone (PubChem CID 82410051) has the molecular formula C8H6N2OS and a molecular weight of 178.22 g/mol. Its IUPAC name is 1-thieno[2,3-b]pyrazin-6-ylethanone.
| Compound Name | 1-thieno[2,3-b]pyrazin-6-ylethanone |
|---|---|
| PubChem CID | 82410051 |
| Molecular Formula | C8H6N2OS |
| Molecular Weight | 178.22 g/mol |
| Exact Mass | 178.02 |
| IUPAC Name | 1-thieno[2,3-b]pyrazin-6-ylethanone |
| SMILES | CC(=O)c1cc2nccnc2s1 |
| InChI | InChI=1S/C8H6N2OS/c1-5(11)7-4-6-8(12-7)10-3-2-9-6/h2-4H,1H3 |
| InChIKey | KVZIPOVKQUMDSQ-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.22 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |