About 2-amino-2-imidazo[1,2-c]pyrimidin-5-ylethanol
2-amino-2-imidazo[1,2-c]pyrimidin-5-ylethanol (PubChem CID 82410065) has the molecular formula C8H10N4O
and a molecular weight of 178.20 g/mol. Its IUPAC name is 2-amino-2-imidazo[1,2-c]pyrimidin-5-ylethanol.
Molecular Properties
| Compound Name | 2-amino-2-imidazo[1,2-c]pyrimidin-5-ylethanol |
| PubChem CID | 82410065 |
| Molecular Formula | C8H10N4O |
| Molecular Weight | 178.20 g/mol |
| Exact Mass | 178.09 |
| IUPAC Name | 2-amino-2-imidazo[1,2-c]pyrimidin-5-ylethanol |
| SMILES | NC(CO)c1nccc2nccn12 |
| InChI | InChI=1S/C8H10N4O/c9-6(5-13)8-11-2-1-7-10-3-4-12(7)8/h1-4,6,13H,5,9H2 |
| InChIKey | IWXUWWZKRCLMHT-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 76.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.20 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-amino-2-imidazo[1,2-c]pyrimidin-5-ylethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-2-imidazo[1,2-c]pyrimidin-5-ylethanol?
The IUPAC name of 2-amino-2-imidazo[1,2-c]pyrimidin-5-ylethanol (CID 82410065) is 2-amino-2-imidazo[1,2-c]pyrimidin-5-ylethanol.
What is the SMILES notation for 2-amino-2-imidazo[1,2-c]pyrimidin-5-ylethanol?
The canonical SMILES for 2-amino-2-imidazo[1,2-c]pyrimidin-5-ylethanol is NC(CO)c1nccc2nccn12.
What is the InChIKey of 2-amino-2-imidazo[1,2-c]pyrimidin-5-ylethanol?
The InChIKey is IWXUWWZKRCLMHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N4O/c9-6(5-13)8-11-2-1-7-10-3-4-12(7)8/h1-4,6,13H,5,9H2.
What are the key properties of 2-amino-2-imidazo[1,2-c]pyrimidin-5-ylethanol?
2-amino-2-imidazo[1,2-c]pyrimidin-5-ylethanol has a molecular weight of 178.20 g/mol, XLogP of -0.28, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-2-imidazo[1,2-c]pyrimidin-5-ylethanol is sourced from PubChem (CID 82410065), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).