About 2-(4-methyl-[1,3]oxazolo[5,4-c]pyridazin-6-yl)ethanamine
2-(4-methyl-[1,3]oxazolo[5,4-c]pyridazin-6-yl)ethanamine (PubChem CID 82410081) has the molecular formula C8H10N4O
and a molecular weight of 178.19 g/mol. Its IUPAC name is 2-(4-methyl-[1,3]oxazolo[5,4-c]pyridazin-6-yl)ethanamine.
Molecular Properties
| Compound Name | 2-(4-methyl-[1,3]oxazolo[5,4-c]pyridazin-6-yl)ethanamine |
| PubChem CID | 82410081 |
| Molecular Formula | C8H10N4O |
| Molecular Weight | 178.19 g/mol |
| Exact Mass | 178.09 |
| IUPAC Name | 2-(4-methyl-[1,3]oxazolo[5,4-c]pyridazin-6-yl)ethanamine |
| SMILES | Cc1cnnc2oc(CCN)nc12 |
| InChI | InChI=1S/C8H10N4O/c1-5-4-10-12-8-7(5)11-6(13-8)2-3-9/h4H,2-3,9H2,1H3 |
| InChIKey | CKCYVMHQNZEWIX-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 77.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.19 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(4-methyl-[1,3]oxazolo[5,4-c]pyridazin-6-yl)ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-methyl-[1,3]oxazolo[5,4-c]pyridazin-6-yl)ethanamine?
The IUPAC name of 2-(4-methyl-[1,3]oxazolo[5,4-c]pyridazin-6-yl)ethanamine (CID 82410081) is 2-(4-methyl-[1,3]oxazolo[5,4-c]pyridazin-6-yl)ethanamine.
What is the SMILES notation for 2-(4-methyl-[1,3]oxazolo[5,4-c]pyridazin-6-yl)ethanamine?
The canonical SMILES for 2-(4-methyl-[1,3]oxazolo[5,4-c]pyridazin-6-yl)ethanamine is Cc1cnnc2oc(CCN)nc12.
What is the InChIKey of 2-(4-methyl-[1,3]oxazolo[5,4-c]pyridazin-6-yl)ethanamine?
The InChIKey is CKCYVMHQNZEWIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N4O/c1-5-4-10-12-8-7(5)11-6(13-8)2-3-9/h4H,2-3,9H2,1H3.
What are the key properties of 2-(4-methyl-[1,3]oxazolo[5,4-c]pyridazin-6-yl)ethanamine?
2-(4-methyl-[1,3]oxazolo[5,4-c]pyridazin-6-yl)ethanamine has a molecular weight of 178.19 g/mol, XLogP of 0.43, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-methyl-[1,3]oxazolo[5,4-c]pyridazin-6-yl)ethanamine is sourced from PubChem (CID 82410081), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).