About 2-(2-aminoethyl)-5,7-dihydropyrrolo[2,3-d]pyrimidin-6-one
2-(2-aminoethyl)-5,7-dihydropyrrolo[2,3-d]pyrimidin-6-one (PubChem CID 82410094) has the molecular formula C8H10N4O
and a molecular weight of 178.19 g/mol. Its IUPAC name is 2-(2-aminoethyl)-5,7-dihydropyrrolo[2,3-d]pyrimidin-6-one.
Molecular Properties
| Compound Name | 2-(2-aminoethyl)-5,7-dihydropyrrolo[2,3-d]pyrimidin-6-one |
| PubChem CID | 82410094 |
| Molecular Formula | C8H10N4O |
| Molecular Weight | 178.19 g/mol |
| Exact Mass | 178.09 |
| IUPAC Name | 2-(2-aminoethyl)-5,7-dihydropyrrolo[2,3-d]pyrimidin-6-one |
| SMILES | NCCc1ncc2c(n1)NC(=O)C2 |
| InChI | InChI=1S/C8H10N4O/c9-2-1-6-10-4-5-3-7(13)12-8(5)11-6/h4H,1-3,9H2,(H,10,11,12,13) |
| InChIKey | CLYVRJCWONXXRY-UHFFFAOYSA-N |
| XLogP | -0.53 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.19 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(2-aminoethyl)-5,7-dihydropyrrolo[2,3-d]pyrimidin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-aminoethyl)-5,7-dihydropyrrolo[2,3-d]pyrimidin-6-one?
The IUPAC name of 2-(2-aminoethyl)-5,7-dihydropyrrolo[2,3-d]pyrimidin-6-one (CID 82410094) is 2-(2-aminoethyl)-5,7-dihydropyrrolo[2,3-d]pyrimidin-6-one.
What is the SMILES notation for 2-(2-aminoethyl)-5,7-dihydropyrrolo[2,3-d]pyrimidin-6-one?
The canonical SMILES for 2-(2-aminoethyl)-5,7-dihydropyrrolo[2,3-d]pyrimidin-6-one is NCCc1ncc2c(n1)NC(=O)C2.
What is the InChIKey of 2-(2-aminoethyl)-5,7-dihydropyrrolo[2,3-d]pyrimidin-6-one?
The InChIKey is CLYVRJCWONXXRY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N4O/c9-2-1-6-10-4-5-3-7(13)12-8(5)11-6/h4H,1-3,9H2,(H,10,11,12,13).
What are the key properties of 2-(2-aminoethyl)-5,7-dihydropyrrolo[2,3-d]pyrimidin-6-one?
2-(2-aminoethyl)-5,7-dihydropyrrolo[2,3-d]pyrimidin-6-one has a molecular weight of 178.19 g/mol, XLogP of -0.53, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-aminoethyl)-5,7-dihydropyrrolo[2,3-d]pyrimidin-6-one is sourced from PubChem (CID 82410094), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).