2-methyl-6,7-dihydro-5H-cyclopenta[d]pyrimidine-6-carboxylic acid

C9H10N2O2 — CID 82410139

IUPAC2-methyl-6,7-dihydro-5H-cyclopenta[d]pyrimidine-6-carboxylic acid
SMILESCc1ncc2c(n1)CC(C(=O)O)C2
InChIInChI=1S/C9H10N2O2/c1-5-10-4-7-2-6(9(12)13)3-8(7)11-5/h4,6H,2-3H2,1H3,(H,12,13)
InChIKeyNPMCEXMFQFTCAK-UHFFFAOYSA-N
MW178.19 g/mol
LogP0.58
Rot. Bonds1

About 2-methyl-6,7-dihydro-5H-cyclopenta[d]pyrimidine-6-carboxylic acid

2-methyl-6,7-dihydro-5H-cyclopenta[d]pyrimidine-6-carboxylic acid (PubChem CID 82410139) has the molecular formula C9H10N2O2 and a molecular weight of 178.19 g/mol. Its IUPAC name is 2-methyl-6,7-dihydro-5H-cyclopenta[d]pyrimidine-6-carboxylic acid.

Molecular Properties

Compound Name2-methyl-6,7-dihydro-5H-cyclopenta[d]pyrimidine-6-carboxylic acid
PubChem CID82410139
Molecular FormulaC9H10N2O2
Molecular Weight178.19 g/mol
Exact Mass178.07
IUPAC Name2-methyl-6,7-dihydro-5H-cyclopenta[d]pyrimidine-6-carboxylic acid
SMILESCc1ncc2c(n1)CC(C(=O)O)C2
InChIInChI=1S/C9H10N2O2/c1-5-10-4-7-2-6(9(12)13)3-8(7)11-5/h4,6H,2-3H2,1H3,(H,12,13)
InChIKeyNPMCEXMFQFTCAK-UHFFFAOYSA-N
XLogP0.58
TPSA63.08 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500178.19
LogP ≤ 50.58
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2-methyl-6,7-dihydro-5H-cyclopenta[d]pyrimidine-6-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-methyl-6,7-dihydro-5H-cyclopenta[d]pyrimidine-6-carboxylic acid?
The IUPAC name of 2-methyl-6,7-dihydro-5H-cyclopenta[d]pyrimidine-6-carboxylic acid (CID 82410139) is 2-methyl-6,7-dihydro-5H-cyclopenta[d]pyrimidine-6-carboxylic acid.
What is the SMILES notation for 2-methyl-6,7-dihydro-5H-cyclopenta[d]pyrimidine-6-carboxylic acid?
The canonical SMILES for 2-methyl-6,7-dihydro-5H-cyclopenta[d]pyrimidine-6-carboxylic acid is Cc1ncc2c(n1)CC(C(=O)O)C2.
What is the InChIKey of 2-methyl-6,7-dihydro-5H-cyclopenta[d]pyrimidine-6-carboxylic acid?
The InChIKey is NPMCEXMFQFTCAK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N2O2/c1-5-10-4-7-2-6(9(12)13)3-8(7)11-5/h4,6H,2-3H2,1H3,(H,12,13).
What are the key properties of 2-methyl-6,7-dihydro-5H-cyclopenta[d]pyrimidine-6-carboxylic acid?
2-methyl-6,7-dihydro-5H-cyclopenta[d]pyrimidine-6-carboxylic acid has a molecular weight of 178.19 g/mol, XLogP of 0.58, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-6,7-dihydro-5H-cyclopenta[d]pyrimidine-6-carboxylic acid is sourced from PubChem (CID 82410139), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).