C11H15NO — CID 82410402
8-methyl-2,3,4,5-tetrahydro-1-benzoxepin-4-amine (PubChem CID 82410402) has the molecular formula C11H15NO and a molecular weight of 177.25 g/mol. Its IUPAC name is 8-methyl-2,3,4,5-tetrahydro-1-benzoxepin-4-amine.
| Compound Name | 8-methyl-2,3,4,5-tetrahydro-1-benzoxepin-4-amine |
|---|---|
| PubChem CID | 82410402 |
| Molecular Formula | C11H15NO |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.12 |
| IUPAC Name | 8-methyl-2,3,4,5-tetrahydro-1-benzoxepin-4-amine |
| SMILES | Cc1ccc2c(c1)OCCC(N)C2 |
| InChI | InChI=1S/C11H15NO/c1-8-2-3-9-7-10(12)4-5-13-11(9)6-8/h2-3,6,10H,4-5,7,12H2,1H3 |
| InChIKey | JNUCBBSOGPCGIW-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |