About 6-oxo-7H-thieno[2,3-b]pyridine-5-carbonitrile
6-oxo-7H-thieno[2,3-b]pyridine-5-carbonitrile (PubChem CID 82410886) has the molecular formula C8H4N2OS
and a molecular weight of 176.20 g/mol. Its IUPAC name is 6-oxo-7H-thieno[2,3-b]pyridine-5-carbonitrile.
Molecular Properties
| Compound Name | 6-oxo-7H-thieno[2,3-b]pyridine-5-carbonitrile |
| PubChem CID | 82410886 |
| Molecular Formula | C8H4N2OS |
| Molecular Weight | 176.20 g/mol |
| Exact Mass | 176.00 |
| IUPAC Name | 6-oxo-7H-thieno[2,3-b]pyridine-5-carbonitrile |
| SMILES | N#Cc1cc2ccsc2[nH]c1=O |
| InChI | InChI=1S/C8H4N2OS/c9-4-6-3-5-1-2-12-8(5)10-7(6)11/h1-3H,(H,10,11) |
| InChIKey | HUZWLEYBXVQGOG-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 56.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.20 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-oxo-7H-thieno[2,3-b]pyridine-5-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-oxo-7H-thieno[2,3-b]pyridine-5-carbonitrile?
The IUPAC name of 6-oxo-7H-thieno[2,3-b]pyridine-5-carbonitrile (CID 82410886) is 6-oxo-7H-thieno[2,3-b]pyridine-5-carbonitrile.
What is the SMILES notation for 6-oxo-7H-thieno[2,3-b]pyridine-5-carbonitrile?
The canonical SMILES for 6-oxo-7H-thieno[2,3-b]pyridine-5-carbonitrile is N#Cc1cc2ccsc2[nH]c1=O.
What is the InChIKey of 6-oxo-7H-thieno[2,3-b]pyridine-5-carbonitrile?
The InChIKey is HUZWLEYBXVQGOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H4N2OS/c9-4-6-3-5-1-2-12-8(5)10-7(6)11/h1-3H,(H,10,11).
What are the key properties of 6-oxo-7H-thieno[2,3-b]pyridine-5-carbonitrile?
6-oxo-7H-thieno[2,3-b]pyridine-5-carbonitrile has a molecular weight of 176.20 g/mol, XLogP of 1.46, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-oxo-7H-thieno[2,3-b]pyridine-5-carbonitrile is sourced from PubChem (CID 82410886), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).