About 4-amino-2,2-dimethylthiolane-3-carboxylic acid
4-amino-2,2-dimethylthiolane-3-carboxylic acid (PubChem CID 82411052) has the molecular formula C7H13NO2S
and a molecular weight of 175.25 g/mol. Its IUPAC name is 4-amino-2,2-dimethylthiolane-3-carboxylic acid.
Molecular Properties
| Compound Name | 4-amino-2,2-dimethylthiolane-3-carboxylic acid |
| PubChem CID | 82411052 |
| Molecular Formula | C7H13NO2S |
| Molecular Weight | 175.25 g/mol |
| Exact Mass | 175.07 |
| IUPAC Name | 4-amino-2,2-dimethylthiolane-3-carboxylic acid |
| SMILES | CC1(C)SCC(N)C1C(=O)O |
| InChI | InChI=1S/C7H13NO2S/c1-7(2)5(6(9)10)4(8)3-11-7/h4-5H,3,8H2,1-2H3,(H,9,10) |
| InChIKey | KWXHWLPBXMSPTI-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.25 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-amino-2,2-dimethylthiolane-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-2,2-dimethylthiolane-3-carboxylic acid?
The IUPAC name of 4-amino-2,2-dimethylthiolane-3-carboxylic acid (CID 82411052) is 4-amino-2,2-dimethylthiolane-3-carboxylic acid.
What is the SMILES notation for 4-amino-2,2-dimethylthiolane-3-carboxylic acid?
The canonical SMILES for 4-amino-2,2-dimethylthiolane-3-carboxylic acid is CC1(C)SCC(N)C1C(=O)O.
What is the InChIKey of 4-amino-2,2-dimethylthiolane-3-carboxylic acid?
The InChIKey is KWXHWLPBXMSPTI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13NO2S/c1-7(2)5(6(9)10)4(8)3-11-7/h4-5H,3,8H2,1-2H3,(H,9,10).
What are the key properties of 4-amino-2,2-dimethylthiolane-3-carboxylic acid?
4-amino-2,2-dimethylthiolane-3-carboxylic acid has a molecular weight of 175.25 g/mol, XLogP of 0.54, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-2,2-dimethylthiolane-3-carboxylic acid is sourced from PubChem (CID 82411052), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).