About 4-oxo-2,3-dihydro-1H-quinoline-6-carbaldehyde
4-oxo-2,3-dihydro-1H-quinoline-6-carbaldehyde (PubChem CID 82411274) has the molecular formula C10H9NO2
and a molecular weight of 175.19 g/mol. Its IUPAC name is 4-oxo-2,3-dihydro-1H-quinoline-6-carbaldehyde.
Molecular Properties
| Compound Name | 4-oxo-2,3-dihydro-1H-quinoline-6-carbaldehyde |
| PubChem CID | 82411274 |
| Molecular Formula | C10H9NO2 |
| Molecular Weight | 175.19 g/mol |
| Exact Mass | 175.06 |
| IUPAC Name | 4-oxo-2,3-dihydro-1H-quinoline-6-carbaldehyde |
| SMILES | O=Cc1ccc2c(c1)C(=O)CCN2 |
| InChI | InChI=1S/C10H9NO2/c12-6-7-1-2-9-8(5-7)10(13)3-4-11-9/h1-2,5-6,11H,3-4H2 |
| InChIKey | VBGBFYODGNHFDN-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.19 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 4-oxo-2,3-dihydro-1H-quinoline-6-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-oxo-2,3-dihydro-1H-quinoline-6-carbaldehyde?
The IUPAC name of 4-oxo-2,3-dihydro-1H-quinoline-6-carbaldehyde (CID 82411274) is 4-oxo-2,3-dihydro-1H-quinoline-6-carbaldehyde.
What is the SMILES notation for 4-oxo-2,3-dihydro-1H-quinoline-6-carbaldehyde?
The canonical SMILES for 4-oxo-2,3-dihydro-1H-quinoline-6-carbaldehyde is O=Cc1ccc2c(c1)C(=O)CCN2.
What is the InChIKey of 4-oxo-2,3-dihydro-1H-quinoline-6-carbaldehyde?
The InChIKey is VBGBFYODGNHFDN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9NO2/c12-6-7-1-2-9-8(5-7)10(13)3-4-11-9/h1-2,5-6,11H,3-4H2.
What are the key properties of 4-oxo-2,3-dihydro-1H-quinoline-6-carbaldehyde?
4-oxo-2,3-dihydro-1H-quinoline-6-carbaldehyde has a molecular weight of 175.19 g/mol, XLogP of 1.50, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-oxo-2,3-dihydro-1H-quinoline-6-carbaldehyde is sourced from PubChem (CID 82411274), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).