About 5-pyridin-3-yl-1,2-oxazole-4-carbaldehyde
5-pyridin-3-yl-1,2-oxazole-4-carbaldehyde (PubChem CID 82411534) has the molecular formula C9H6N2O2
and a molecular weight of 174.16 g/mol. Its IUPAC name is 5-pyridin-3-yl-1,2-oxazole-4-carbaldehyde.
Molecular Properties
| Compound Name | 5-pyridin-3-yl-1,2-oxazole-4-carbaldehyde |
| PubChem CID | 82411534 |
| Molecular Formula | C9H6N2O2 |
| Molecular Weight | 174.16 g/mol |
| Exact Mass | 174.04 |
| IUPAC Name | 5-pyridin-3-yl-1,2-oxazole-4-carbaldehyde |
| SMILES | O=Cc1cnoc1-c1cccnc1 |
| InChI | InChI=1S/C9H6N2O2/c12-6-8-5-11-13-9(8)7-2-1-3-10-4-7/h1-6H |
| InChIKey | ZCODWRJSTMTPMK-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 55.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.16 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 5-pyridin-3-yl-1,2-oxazole-4-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-pyridin-3-yl-1,2-oxazole-4-carbaldehyde?
The IUPAC name of 5-pyridin-3-yl-1,2-oxazole-4-carbaldehyde (CID 82411534) is 5-pyridin-3-yl-1,2-oxazole-4-carbaldehyde.
What is the SMILES notation for 5-pyridin-3-yl-1,2-oxazole-4-carbaldehyde?
The canonical SMILES for 5-pyridin-3-yl-1,2-oxazole-4-carbaldehyde is O=Cc1cnoc1-c1cccnc1.
What is the InChIKey of 5-pyridin-3-yl-1,2-oxazole-4-carbaldehyde?
The InChIKey is ZCODWRJSTMTPMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6N2O2/c12-6-8-5-11-13-9(8)7-2-1-3-10-4-7/h1-6H.
What are the key properties of 5-pyridin-3-yl-1,2-oxazole-4-carbaldehyde?
5-pyridin-3-yl-1,2-oxazole-4-carbaldehyde has a molecular weight of 174.16 g/mol, XLogP of 1.55, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-pyridin-3-yl-1,2-oxazole-4-carbaldehyde is sourced from PubChem (CID 82411534), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).