C8H16N2S — CID 82411746
1,3,4,6,7,8,9,9a-octahydropyrido[2,1-c][1,4]thiazin-9-amine (PubChem CID 82411746) has the molecular formula C8H16N2S and a molecular weight of 172.30 g/mol. Its IUPAC name is 1,3,4,6,7,8,9,9a-octahydropyrido[2,1-c][1,4]thiazin-9-amine.
| Compound Name | 1,3,4,6,7,8,9,9a-octahydropyrido[2,1-c][1,4]thiazin-9-amine |
|---|---|
| PubChem CID | 82411746 |
| Molecular Formula | C8H16N2S |
| Molecular Weight | 172.30 g/mol |
| Exact Mass | 172.10 |
| IUPAC Name | 1,3,4,6,7,8,9,9a-octahydropyrido[2,1-c][1,4]thiazin-9-amine |
| SMILES | NC1CCCN2CCSCC12 |
| InChI | InChI=1S/C8H16N2S/c9-7-2-1-3-10-4-5-11-6-8(7)10/h7-8H,1-6,9H2 |
| InChIKey | UWZBGYSOLLBLIX-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.30 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |