About 2-amino-N-(1,2,4-thiadiazol-5-ylmethyl)acetamide
2-amino-N-(1,2,4-thiadiazol-5-ylmethyl)acetamide (PubChem CID 82411866) has the molecular formula C5H8N4OS
and a molecular weight of 172.21 g/mol. Its IUPAC name is 2-amino-N-(1,2,4-thiadiazol-5-ylmethyl)acetamide.
Molecular Properties
| Compound Name | 2-amino-N-(1,2,4-thiadiazol-5-ylmethyl)acetamide |
| PubChem CID | 82411866 |
| Molecular Formula | C5H8N4OS |
| Molecular Weight | 172.21 g/mol |
| Exact Mass | 172.04 |
| IUPAC Name | 2-amino-N-(1,2,4-thiadiazol-5-ylmethyl)acetamide |
| SMILES | NCC(=O)NCc1ncns1 |
| InChI | InChI=1S/C5H8N4OS/c6-1-4(10)7-2-5-8-3-9-11-5/h3H,1-2,6H2,(H,7,10) |
| InChIKey | OONLYNYLUGSZDD-UHFFFAOYSA-N |
| XLogP | -0.89 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.21 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-amino-N-(1,2,4-thiadiazol-5-ylmethyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-N-(1,2,4-thiadiazol-5-ylmethyl)acetamide?
The IUPAC name of 2-amino-N-(1,2,4-thiadiazol-5-ylmethyl)acetamide (CID 82411866) is 2-amino-N-(1,2,4-thiadiazol-5-ylmethyl)acetamide.
What is the SMILES notation for 2-amino-N-(1,2,4-thiadiazol-5-ylmethyl)acetamide?
The canonical SMILES for 2-amino-N-(1,2,4-thiadiazol-5-ylmethyl)acetamide is NCC(=O)NCc1ncns1.
What is the InChIKey of 2-amino-N-(1,2,4-thiadiazol-5-ylmethyl)acetamide?
The InChIKey is OONLYNYLUGSZDD-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8N4OS/c6-1-4(10)7-2-5-8-3-9-11-5/h3H,1-2,6H2,(H,7,10).
What are the key properties of 2-amino-N-(1,2,4-thiadiazol-5-ylmethyl)acetamide?
2-amino-N-(1,2,4-thiadiazol-5-ylmethyl)acetamide has a molecular weight of 172.21 g/mol, XLogP of -0.89, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-N-(1,2,4-thiadiazol-5-ylmethyl)acetamide is sourced from PubChem (CID 82411866), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).