About 4-(1,3-oxazol-2-yl)pyridine-3-carbonitrile
4-(1,3-oxazol-2-yl)pyridine-3-carbonitrile (PubChem CID 82412176) has the molecular formula C9H5N3O
and a molecular weight of 171.16 g/mol. Its IUPAC name is 4-(1,3-oxazol-2-yl)pyridine-3-carbonitrile.
Molecular Properties
| Compound Name | 4-(1,3-oxazol-2-yl)pyridine-3-carbonitrile |
| PubChem CID | 82412176 |
| Molecular Formula | C9H5N3O |
| Molecular Weight | 171.16 g/mol |
| Exact Mass | 171.04 |
| IUPAC Name | 4-(1,3-oxazol-2-yl)pyridine-3-carbonitrile |
| SMILES | N#Cc1cnccc1-c1ncco1 |
| InChI | InChI=1S/C9H5N3O/c10-5-7-6-11-2-1-8(7)9-12-3-4-13-9/h1-4,6H |
| InChIKey | AKLHTSSOCWPIPH-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 62.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.16 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(1,3-oxazol-2-yl)pyridine-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1,3-oxazol-2-yl)pyridine-3-carbonitrile?
The IUPAC name of 4-(1,3-oxazol-2-yl)pyridine-3-carbonitrile (CID 82412176) is 4-(1,3-oxazol-2-yl)pyridine-3-carbonitrile.
What is the SMILES notation for 4-(1,3-oxazol-2-yl)pyridine-3-carbonitrile?
The canonical SMILES for 4-(1,3-oxazol-2-yl)pyridine-3-carbonitrile is N#Cc1cnccc1-c1ncco1.
What is the InChIKey of 4-(1,3-oxazol-2-yl)pyridine-3-carbonitrile?
The InChIKey is AKLHTSSOCWPIPH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H5N3O/c10-5-7-6-11-2-1-8(7)9-12-3-4-13-9/h1-4,6H.
What are the key properties of 4-(1,3-oxazol-2-yl)pyridine-3-carbonitrile?
4-(1,3-oxazol-2-yl)pyridine-3-carbonitrile has a molecular weight of 171.16 g/mol, XLogP of 1.61, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1,3-oxazol-2-yl)pyridine-3-carbonitrile is sourced from PubChem (CID 82412176), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).