About (1R)-3-methyl-1-(1,2-thiazol-3-yl)butan-1-amine
(1R)-3-methyl-1-(1,2-thiazol-3-yl)butan-1-amine (PubChem CID 82412307) has the molecular formula C8H14N2S
and a molecular weight of 170.28 g/mol. Its IUPAC name is (1R)-3-methyl-1-(1,2-thiazol-3-yl)butan-1-amine.
Molecular Properties
| Compound Name | (1R)-3-methyl-1-(1,2-thiazol-3-yl)butan-1-amine |
| PubChem CID | 82412307 |
| Molecular Formula | C8H14N2S |
| Molecular Weight | 170.28 g/mol |
| Exact Mass | 170.09 |
| IUPAC Name | (1R)-3-methyl-1-(1,2-thiazol-3-yl)butan-1-amine |
| SMILES | CC(C)C[C@@H](N)c1ccsn1 |
| InChI | InChI=1S/C8H14N2S/c1-6(2)5-7(9)8-3-4-11-10-8/h3-4,6-7H,5,9H2,1-2H3/t7-/m1/s1 |
| InChIKey | PVKWKMPFWJNXOF-SSDOTTSWSA-N |
| XLogP | 2.19 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.28 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (1R)-3-methyl-1-(1,2-thiazol-3-yl)butan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R)-3-methyl-1-(1,2-thiazol-3-yl)butan-1-amine?
The IUPAC name of (1R)-3-methyl-1-(1,2-thiazol-3-yl)butan-1-amine (CID 82412307) is (1R)-3-methyl-1-(1,2-thiazol-3-yl)butan-1-amine.
What is the SMILES notation for (1R)-3-methyl-1-(1,2-thiazol-3-yl)butan-1-amine?
The canonical SMILES for (1R)-3-methyl-1-(1,2-thiazol-3-yl)butan-1-amine is CC(C)C[C@@H](N)c1ccsn1.
What is the InChIKey of (1R)-3-methyl-1-(1,2-thiazol-3-yl)butan-1-amine?
The InChIKey is PVKWKMPFWJNXOF-SSDOTTSWSA-N. The full InChI is InChI=1S/C8H14N2S/c1-6(2)5-7(9)8-3-4-11-10-8/h3-4,6-7H,5,9H2,1-2H3/t7-/m1/s1.
What are the key properties of (1R)-3-methyl-1-(1,2-thiazol-3-yl)butan-1-amine?
(1R)-3-methyl-1-(1,2-thiazol-3-yl)butan-1-amine has a molecular weight of 170.28 g/mol, XLogP of 2.19, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1R)-3-methyl-1-(1,2-thiazol-3-yl)butan-1-amine is sourced from PubChem (CID 82412307), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).