C9H18N2O — CID 82412322
1,3,4,6,7,8,9,9a-octahydropyrido[2,1-c][1,4]oxazin-8-ylmethanamine (PubChem CID 82412322) has the molecular formula C9H18N2O and a molecular weight of 170.26 g/mol. Its IUPAC name is 1,3,4,6,7,8,9,9a-octahydropyrido[2,1-c][1,4]oxazin-8-ylmethanamine.
| Compound Name | 1,3,4,6,7,8,9,9a-octahydropyrido[2,1-c][1,4]oxazin-8-ylmethanamine |
|---|---|
| PubChem CID | 82412322 |
| Molecular Formula | C9H18N2O |
| Molecular Weight | 170.26 g/mol |
| Exact Mass | 170.14 |
| IUPAC Name | 1,3,4,6,7,8,9,9a-octahydropyrido[2,1-c][1,4]oxazin-8-ylmethanamine |
| SMILES | NCC1CCN2CCOCC2C1 |
| InChI | InChI=1S/C9H18N2O/c10-6-8-1-2-11-3-4-12-7-9(11)5-8/h8-9H,1-7,10H2 |
| InChIKey | PAKAPTPPUQDCQM-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.26 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |