About 1-methyl-9-oxa-1,4-diazaspiro[5.5]undecane
1-methyl-9-oxa-1,4-diazaspiro[5.5]undecane (PubChem CID 82412329) has the molecular formula C9H18N2O
and a molecular weight of 170.26 g/mol. Its IUPAC name is 1-methyl-9-oxa-1,4-diazaspiro[5.5]undecane.
Molecular Properties
| Compound Name | 1-methyl-9-oxa-1,4-diazaspiro[5.5]undecane |
| PubChem CID | 82412329 |
| Molecular Formula | C9H18N2O |
| Molecular Weight | 170.26 g/mol |
| Exact Mass | 170.14 |
| IUPAC Name | 1-methyl-9-oxa-1,4-diazaspiro[5.5]undecane |
| SMILES | CN1CCNCC12CCOCC2 |
| InChI | InChI=1S/C9H18N2O/c1-11-5-4-10-8-9(11)2-6-12-7-3-9/h10H,2-8H2,1H3 |
| InChIKey | GPJFHASOAPGDOH-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.26 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-methyl-9-oxa-1,4-diazaspiro[5.5]undecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-9-oxa-1,4-diazaspiro[5.5]undecane?
The IUPAC name of 1-methyl-9-oxa-1,4-diazaspiro[5.5]undecane (CID 82412329) is 1-methyl-9-oxa-1,4-diazaspiro[5.5]undecane.
What is the SMILES notation for 1-methyl-9-oxa-1,4-diazaspiro[5.5]undecane?
The canonical SMILES for 1-methyl-9-oxa-1,4-diazaspiro[5.5]undecane is CN1CCNCC12CCOCC2.
What is the InChIKey of 1-methyl-9-oxa-1,4-diazaspiro[5.5]undecane?
The InChIKey is GPJFHASOAPGDOH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18N2O/c1-11-5-4-10-8-9(11)2-6-12-7-3-9/h10H,2-8H2,1H3.
What are the key properties of 1-methyl-9-oxa-1,4-diazaspiro[5.5]undecane?
1-methyl-9-oxa-1,4-diazaspiro[5.5]undecane has a molecular weight of 170.26 g/mol, XLogP of 0.07, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-9-oxa-1,4-diazaspiro[5.5]undecane is sourced from PubChem (CID 82412329), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).