About 2-(4,5-dimethyl-2-sulfanylidene-1H-imidazol-3-yl)acetaldehyde
2-(4,5-dimethyl-2-sulfanylidene-1H-imidazol-3-yl)acetaldehyde (PubChem CID 82412403) has the molecular formula C7H10N2OS
and a molecular weight of 170.24 g/mol. Its IUPAC name is 2-(4,5-dimethyl-2-sulfanylidene-1H-imidazol-3-yl)acetaldehyde.
Molecular Properties
| Compound Name | 2-(4,5-dimethyl-2-sulfanylidene-1H-imidazol-3-yl)acetaldehyde |
| PubChem CID | 82412403 |
| Molecular Formula | C7H10N2OS |
| Molecular Weight | 170.24 g/mol |
| Exact Mass | 170.05 |
| IUPAC Name | 2-(4,5-dimethyl-2-sulfanylidene-1H-imidazol-3-yl)acetaldehyde |
| SMILES | Cc1[nH]c(=S)n(CC=O)c1C |
| InChI | InChI=1S/C7H10N2OS/c1-5-6(2)9(3-4-10)7(11)8-5/h4H,3H2,1-2H3,(H,8,11) |
| InChIKey | DTLUVMURYOHDIA-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 37.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.24 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-(4,5-dimethyl-2-sulfanylidene-1H-imidazol-3-yl)acetaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4,5-dimethyl-2-sulfanylidene-1H-imidazol-3-yl)acetaldehyde?
The IUPAC name of 2-(4,5-dimethyl-2-sulfanylidene-1H-imidazol-3-yl)acetaldehyde (CID 82412403) is 2-(4,5-dimethyl-2-sulfanylidene-1H-imidazol-3-yl)acetaldehyde.
What is the SMILES notation for 2-(4,5-dimethyl-2-sulfanylidene-1H-imidazol-3-yl)acetaldehyde?
The canonical SMILES for 2-(4,5-dimethyl-2-sulfanylidene-1H-imidazol-3-yl)acetaldehyde is Cc1[nH]c(=S)n(CC=O)c1C.
What is the InChIKey of 2-(4,5-dimethyl-2-sulfanylidene-1H-imidazol-3-yl)acetaldehyde?
The InChIKey is DTLUVMURYOHDIA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2OS/c1-5-6(2)9(3-4-10)7(11)8-5/h4H,3H2,1-2H3,(H,8,11).
What are the key properties of 2-(4,5-dimethyl-2-sulfanylidene-1H-imidazol-3-yl)acetaldehyde?
2-(4,5-dimethyl-2-sulfanylidene-1H-imidazol-3-yl)acetaldehyde has a molecular weight of 170.24 g/mol, XLogP of 1.36, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4,5-dimethyl-2-sulfanylidene-1H-imidazol-3-yl)acetaldehyde is sourced from PubChem (CID 82412403), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).