About 2-(1,3-dimethyl-1,3-diazinan-2-ylidene)acetic acid
2-(1,3-dimethyl-1,3-diazinan-2-ylidene)acetic acid (PubChem CID 82412453) has the molecular formula C8H14N2O2
and a molecular weight of 170.21 g/mol. Its IUPAC name is 2-(1,3-dimethyl-1,3-diazinan-2-ylidene)acetic acid.
Molecular Properties
| Compound Name | 2-(1,3-dimethyl-1,3-diazinan-2-ylidene)acetic acid |
| PubChem CID | 82412453 |
| Molecular Formula | C8H14N2O2 |
| Molecular Weight | 170.21 g/mol |
| Exact Mass | 170.11 |
| IUPAC Name | 2-(1,3-dimethyl-1,3-diazinan-2-ylidene)acetic acid |
| SMILES | CN1CCCN(C)C1=CC(=O)O |
| InChI | InChI=1S/C8H14N2O2/c1-9-4-3-5-10(2)7(9)6-8(11)12/h6H,3-5H2,1-2H3,(H,11,12) |
| InChIKey | YYLWIVVWMCVQGH-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.21 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(1,3-dimethyl-1,3-diazinan-2-ylidene)acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,3-dimethyl-1,3-diazinan-2-ylidene)acetic acid?
The IUPAC name of 2-(1,3-dimethyl-1,3-diazinan-2-ylidene)acetic acid (CID 82412453) is 2-(1,3-dimethyl-1,3-diazinan-2-ylidene)acetic acid.
What is the SMILES notation for 2-(1,3-dimethyl-1,3-diazinan-2-ylidene)acetic acid?
The canonical SMILES for 2-(1,3-dimethyl-1,3-diazinan-2-ylidene)acetic acid is CN1CCCN(C)C1=CC(=O)O.
What is the InChIKey of 2-(1,3-dimethyl-1,3-diazinan-2-ylidene)acetic acid?
The InChIKey is YYLWIVVWMCVQGH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N2O2/c1-9-4-3-5-10(2)7(9)6-8(11)12/h6H,3-5H2,1-2H3,(H,11,12).
What are the key properties of 2-(1,3-dimethyl-1,3-diazinan-2-ylidene)acetic acid?
2-(1,3-dimethyl-1,3-diazinan-2-ylidene)acetic acid has a molecular weight of 170.21 g/mol, XLogP of 0.18, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,3-dimethyl-1,3-diazinan-2-ylidene)acetic acid is sourced from PubChem (CID 82412453), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).