About 2-(aminomethyl)-3-(1,3-oxazol-5-yl)propanoic acid
2-(aminomethyl)-3-(1,3-oxazol-5-yl)propanoic acid (PubChem CID 82412552) has the molecular formula C7H10N2O3
and a molecular weight of 170.17 g/mol. Its IUPAC name is 2-(aminomethyl)-3-(1,3-oxazol-5-yl)propanoic acid.
Molecular Properties
| Compound Name | 2-(aminomethyl)-3-(1,3-oxazol-5-yl)propanoic acid |
| PubChem CID | 82412552 |
| Molecular Formula | C7H10N2O3 |
| Molecular Weight | 170.17 g/mol |
| Exact Mass | 170.07 |
| IUPAC Name | 2-(aminomethyl)-3-(1,3-oxazol-5-yl)propanoic acid |
| SMILES | NCC(Cc1cnco1)C(=O)O |
| InChI | InChI=1S/C7H10N2O3/c8-2-5(7(10)11)1-6-3-9-4-12-6/h3-5H,1-2,8H2,(H,10,11) |
| InChIKey | CQZJZKUZBVSZJZ-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 89.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.17 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(aminomethyl)-3-(1,3-oxazol-5-yl)propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(aminomethyl)-3-(1,3-oxazol-5-yl)propanoic acid?
The IUPAC name of 2-(aminomethyl)-3-(1,3-oxazol-5-yl)propanoic acid (CID 82412552) is 2-(aminomethyl)-3-(1,3-oxazol-5-yl)propanoic acid.
What is the SMILES notation for 2-(aminomethyl)-3-(1,3-oxazol-5-yl)propanoic acid?
The canonical SMILES for 2-(aminomethyl)-3-(1,3-oxazol-5-yl)propanoic acid is NCC(Cc1cnco1)C(=O)O.
What is the InChIKey of 2-(aminomethyl)-3-(1,3-oxazol-5-yl)propanoic acid?
The InChIKey is CQZJZKUZBVSZJZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2O3/c8-2-5(7(10)11)1-6-3-9-4-12-6/h3-5H,1-2,8H2,(H,10,11).
What are the key properties of 2-(aminomethyl)-3-(1,3-oxazol-5-yl)propanoic acid?
2-(aminomethyl)-3-(1,3-oxazol-5-yl)propanoic acid has a molecular weight of 170.17 g/mol, XLogP of -0.12, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(aminomethyl)-3-(1,3-oxazol-5-yl)propanoic acid is sourced from PubChem (CID 82412552), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).