C9H19N3 — CID 82412641
(2-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-8-yl)methanamine (PubChem CID 82412641) has the molecular formula C9H19N3 and a molecular weight of 169.27 g/mol. Its IUPAC name is (2-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-8-yl)methanamine.
| Compound Name | (2-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-8-yl)methanamine |
|---|---|
| PubChem CID | 82412641 |
| Molecular Formula | C9H19N3 |
| Molecular Weight | 169.27 g/mol |
| Exact Mass | 169.16 |
| IUPAC Name | (2-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-8-yl)methanamine |
| SMILES | CN1CCN2CCC(CN)C2C1 |
| InChI | InChI=1S/C9H19N3/c1-11-4-5-12-3-2-8(6-10)9(12)7-11/h8-9H,2-7,10H2,1H3 |
| InChIKey | QSWPQGYMFUGNIY-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.27 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |