About 4-(3-methyl-1,2-oxazol-5-yl)butanoic acid
4-(3-methyl-1,2-oxazol-5-yl)butanoic acid (PubChem CID 82412955) has the molecular formula C8H11NO3
and a molecular weight of 169.18 g/mol. Its IUPAC name is 4-(3-methyl-1,2-oxazol-5-yl)butanoic acid.
Molecular Properties
| Compound Name | 4-(3-methyl-1,2-oxazol-5-yl)butanoic acid |
| PubChem CID | 82412955 |
| Molecular Formula | C8H11NO3 |
| Molecular Weight | 169.18 g/mol |
| Exact Mass | 169.07 |
| IUPAC Name | 4-(3-methyl-1,2-oxazol-5-yl)butanoic acid |
| SMILES | Cc1cc(CCCC(=O)O)on1 |
| InChI | InChI=1S/C8H11NO3/c1-6-5-7(12-9-6)3-2-4-8(10)11/h5H,2-4H2,1H3,(H,10,11) |
| InChIKey | JGDNWRXFTCHCBR-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.18 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(3-methyl-1,2-oxazol-5-yl)butanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3-methyl-1,2-oxazol-5-yl)butanoic acid?
The IUPAC name of 4-(3-methyl-1,2-oxazol-5-yl)butanoic acid (CID 82412955) is 4-(3-methyl-1,2-oxazol-5-yl)butanoic acid.
What is the SMILES notation for 4-(3-methyl-1,2-oxazol-5-yl)butanoic acid?
The canonical SMILES for 4-(3-methyl-1,2-oxazol-5-yl)butanoic acid is Cc1cc(CCCC(=O)O)on1.
What is the InChIKey of 4-(3-methyl-1,2-oxazol-5-yl)butanoic acid?
The InChIKey is JGDNWRXFTCHCBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11NO3/c1-6-5-7(12-9-6)3-2-4-8(10)11/h5H,2-4H2,1H3,(H,10,11).
What are the key properties of 4-(3-methyl-1,2-oxazol-5-yl)butanoic acid?
4-(3-methyl-1,2-oxazol-5-yl)butanoic acid has a molecular weight of 169.18 g/mol, XLogP of 1.39, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3-methyl-1,2-oxazol-5-yl)butanoic acid is sourced from PubChem (CID 82412955), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).