About 5,7-dihydro-4H-pyrano[4,3-d][1,2]oxazole-3-carboxylic acid
5,7-dihydro-4H-pyrano[4,3-d][1,2]oxazole-3-carboxylic acid (PubChem CID 82412985) has the molecular formula C7H7NO4
and a molecular weight of 169.14 g/mol. Its IUPAC name is 5,7-dihydro-4H-pyrano[4,3-d][1,2]oxazole-3-carboxylic acid.
Analyze 5,7-dihydro-4H-pyrano[4,3-d][1,2]oxazole-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,7-dihydro-4H-pyrano[4,3-d][1,2]oxazole-3-carboxylic acid?
The IUPAC name of 5,7-dihydro-4H-pyrano[4,3-d][1,2]oxazole-3-carboxylic acid (CID 82412985) is 5,7-dihydro-4H-pyrano[4,3-d][1,2]oxazole-3-carboxylic acid.
What is the SMILES notation for 5,7-dihydro-4H-pyrano[4,3-d][1,2]oxazole-3-carboxylic acid?
The canonical SMILES for 5,7-dihydro-4H-pyrano[4,3-d][1,2]oxazole-3-carboxylic acid is O=C(O)c1noc2c1CCOC2.
What is the InChIKey of 5,7-dihydro-4H-pyrano[4,3-d][1,2]oxazole-3-carboxylic acid?
The InChIKey is VETPTNLPIYJFGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7NO4/c9-7(10)6-4-1-2-11-3-5(4)12-8-6/h1-3H2,(H,9,10).
What are the key properties of 5,7-dihydro-4H-pyrano[4,3-d][1,2]oxazole-3-carboxylic acid?
5,7-dihydro-4H-pyrano[4,3-d][1,2]oxazole-3-carboxylic acid has a molecular weight of 169.14 g/mol, XLogP of 0.45, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5,7-dihydro-4H-pyrano[4,3-d][1,2]oxazole-3-carboxylic acid is sourced from PubChem (CID 82412985), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).