6,8-dihydro-5H-imidazo[5,1-c][1,4]oxazine-1-carboxylic acid

C7H8N2O3 — CID 82413449

IUPAC6,8-dihydro-5H-imidazo[5,1-c][1,4]oxazine-1-carboxylic acid
SMILESO=C(O)c1ncn2c1COCC2
InChIInChI=1S/C7H8N2O3/c10-7(11)6-5-3-12-2-1-9(5)4-8-6/h4H,1-3H2,(H,10,11)
InChIKeyWIIFWTGAOKZUMC-UHFFFAOYSA-N
MW168.15 g/mol
LogP0.11
Rot. Bonds1

About 6,8-dihydro-5H-imidazo[5,1-c][1,4]oxazine-1-carboxylic acid

6,8-dihydro-5H-imidazo[5,1-c][1,4]oxazine-1-carboxylic acid (PubChem CID 82413449) has the molecular formula C7H8N2O3 and a molecular weight of 168.15 g/mol. Its IUPAC name is 6,8-dihydro-5H-imidazo[5,1-c][1,4]oxazine-1-carboxylic acid.

Molecular Properties

Compound Name6,8-dihydro-5H-imidazo[5,1-c][1,4]oxazine-1-carboxylic acid
PubChem CID82413449
Molecular FormulaC7H8N2O3
Molecular Weight168.15 g/mol
Exact Mass168.05
IUPAC Name6,8-dihydro-5H-imidazo[5,1-c][1,4]oxazine-1-carboxylic acid
SMILESO=C(O)c1ncn2c1COCC2
InChIInChI=1S/C7H8N2O3/c10-7(11)6-5-3-12-2-1-9(5)4-8-6/h4H,1-3H2,(H,10,11)
InChIKeyWIIFWTGAOKZUMC-UHFFFAOYSA-N
XLogP0.11
TPSA64.35 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds1
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500168.15
LogP ≤ 50.11
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 6,8-dihydro-5H-imidazo[5,1-c][1,4]oxazine-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 6,8-dihydro-5H-imidazo[5,1-c][1,4]oxazine-1-carboxylic acid?
The IUPAC name of 6,8-dihydro-5H-imidazo[5,1-c][1,4]oxazine-1-carboxylic acid (CID 82413449) is 6,8-dihydro-5H-imidazo[5,1-c][1,4]oxazine-1-carboxylic acid.
What is the SMILES notation for 6,8-dihydro-5H-imidazo[5,1-c][1,4]oxazine-1-carboxylic acid?
The canonical SMILES for 6,8-dihydro-5H-imidazo[5,1-c][1,4]oxazine-1-carboxylic acid is O=C(O)c1ncn2c1COCC2.
What is the InChIKey of 6,8-dihydro-5H-imidazo[5,1-c][1,4]oxazine-1-carboxylic acid?
The InChIKey is WIIFWTGAOKZUMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N2O3/c10-7(11)6-5-3-12-2-1-9(5)4-8-6/h4H,1-3H2,(H,10,11).
What are the key properties of 6,8-dihydro-5H-imidazo[5,1-c][1,4]oxazine-1-carboxylic acid?
6,8-dihydro-5H-imidazo[5,1-c][1,4]oxazine-1-carboxylic acid has a molecular weight of 168.15 g/mol, XLogP of 0.11, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6,8-dihydro-5H-imidazo[5,1-c][1,4]oxazine-1-carboxylic acid is sourced from PubChem (CID 82413449), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).