C8H9NOS — CID 82413649
5,6,7,8-tetrahydrothieno[3,4-c]azepin-4-one (PubChem CID 82413649) has the molecular formula C8H9NOS and a molecular weight of 167.23 g/mol. Its IUPAC name is 5,6,7,8-tetrahydrothieno[3,4-c]azepin-4-one.
| Compound Name | 5,6,7,8-tetrahydrothieno[3,4-c]azepin-4-one |
|---|---|
| PubChem CID | 82413649 |
| Molecular Formula | C8H9NOS |
| Molecular Weight | 167.23 g/mol |
| Exact Mass | 167.04 |
| IUPAC Name | 5,6,7,8-tetrahydrothieno[3,4-c]azepin-4-one |
| SMILES | O=C1NCCCc2cscc21 |
| InChI | InChI=1S/C8H9NOS/c10-8-7-5-11-4-6(7)2-1-3-9-8/h4-5H,1-3H2,(H,9,10) |
| InChIKey | DAXGAHZDPBTMSR-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.23 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |