About 2-(5-cyclopropyl-1,2-oxazol-3-yl)acetic acid
2-(5-cyclopropyl-1,2-oxazol-3-yl)acetic acid (PubChem CID 82413932) has the molecular formula C8H9NO3
and a molecular weight of 167.16 g/mol. Its IUPAC name is 2-(5-cyclopropyl-1,2-oxazol-3-yl)acetic acid.
Molecular Properties
| Compound Name | 2-(5-cyclopropyl-1,2-oxazol-3-yl)acetic acid |
| PubChem CID | 82413932 |
| Molecular Formula | C8H9NO3 |
| Molecular Weight | 167.16 g/mol |
| Exact Mass | 167.06 |
| IUPAC Name | 2-(5-cyclopropyl-1,2-oxazol-3-yl)acetic acid |
| SMILES | O=C(O)Cc1cc(C2CC2)on1 |
| InChI | InChI=1S/C8H9NO3/c10-8(11)4-6-3-7(12-9-6)5-1-2-5/h3,5H,1-2,4H2,(H,10,11) |
| InChIKey | BHBXFEXSJWIJKJ-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.16 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(5-cyclopropyl-1,2-oxazol-3-yl)acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5-cyclopropyl-1,2-oxazol-3-yl)acetic acid?
The IUPAC name of 2-(5-cyclopropyl-1,2-oxazol-3-yl)acetic acid (CID 82413932) is 2-(5-cyclopropyl-1,2-oxazol-3-yl)acetic acid.
What is the SMILES notation for 2-(5-cyclopropyl-1,2-oxazol-3-yl)acetic acid?
The canonical SMILES for 2-(5-cyclopropyl-1,2-oxazol-3-yl)acetic acid is O=C(O)Cc1cc(C2CC2)on1.
What is the InChIKey of 2-(5-cyclopropyl-1,2-oxazol-3-yl)acetic acid?
The InChIKey is BHBXFEXSJWIJKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NO3/c10-8(11)4-6-3-7(12-9-6)5-1-2-5/h3,5H,1-2,4H2,(H,10,11).
What are the key properties of 2-(5-cyclopropyl-1,2-oxazol-3-yl)acetic acid?
2-(5-cyclopropyl-1,2-oxazol-3-yl)acetic acid has a molecular weight of 167.16 g/mol, XLogP of 1.18, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-cyclopropyl-1,2-oxazol-3-yl)acetic acid is sourced from PubChem (CID 82413932), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).