About 4-methoxy-2,3,6-trimethylbenzaldehyde
4-methoxy-2,3,6-trimethylbenzaldehyde (PubChem CID 824142) has the molecular formula C11H14O2
and a molecular weight of 178.23 g/mol. Its IUPAC name is 4-methoxy-2,3,6-trimethylbenzaldehyde.
Molecular Properties
| Compound Name | 4-methoxy-2,3,6-trimethylbenzaldehyde |
| PubChem CID | 824142 |
| Molecular Formula | C11H14O2 |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.10 |
| IUPAC Name | 4-methoxy-2,3,6-trimethylbenzaldehyde |
| SMILES | COc1cc(C)c(C=O)c(C)c1C |
| InChI | InChI=1S/C11H14O2/c1-7-5-11(13-4)9(3)8(2)10(7)6-12/h5-6H,1-4H3 |
| InChIKey | BTOFIDLWQJCUJG-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 4-methoxy-2,3,6-trimethylbenzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methoxy-2,3,6-trimethylbenzaldehyde?
The IUPAC name of 4-methoxy-2,3,6-trimethylbenzaldehyde (CID 824142) is 4-methoxy-2,3,6-trimethylbenzaldehyde.
What is the SMILES notation for 4-methoxy-2,3,6-trimethylbenzaldehyde?
The canonical SMILES for 4-methoxy-2,3,6-trimethylbenzaldehyde is COc1cc(C)c(C=O)c(C)c1C.
What is the InChIKey of 4-methoxy-2,3,6-trimethylbenzaldehyde?
The InChIKey is BTOFIDLWQJCUJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14O2/c1-7-5-11(13-4)9(3)8(2)10(7)6-12/h5-6H,1-4H3.
What are the key properties of 4-methoxy-2,3,6-trimethylbenzaldehyde?
4-methoxy-2,3,6-trimethylbenzaldehyde has a molecular weight of 178.23 g/mol, XLogP of 2.43, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methoxy-2,3,6-trimethylbenzaldehyde is sourced from PubChem (CID 824142), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).