C9H15N3 — CID 82414484
(1S)-1-(4,5,6,7-tetrahydro-1H-indazol-3-yl)ethanamine (PubChem CID 82414484) has the molecular formula C9H15N3 and a molecular weight of 165.24 g/mol. Its IUPAC name is (1S)-1-(4,5,6,7-tetrahydro-1H-indazol-3-yl)ethanamine.
| Compound Name | (1S)-1-(4,5,6,7-tetrahydro-1H-indazol-3-yl)ethanamine |
|---|---|
| PubChem CID | 82414484 |
| Molecular Formula | C9H15N3 |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.13 |
| IUPAC Name | (1S)-1-(4,5,6,7-tetrahydro-1H-indazol-3-yl)ethanamine |
| SMILES | C[C@H](N)c1n[nH]c2c1CCCC2 |
| InChI | InChI=1S/C9H15N3/c1-6(10)9-7-4-2-3-5-8(7)11-12-9/h6H,2-5,10H2,1H3,(H,11,12)/t6-/m0/s1 |
| InChIKey | SRIBTQQZZYHMEJ-LURJTMIESA-N |
| XLogP | 1.31 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |