About 5-cyclopentyl-1,3-oxazole-4-carbaldehyde
5-cyclopentyl-1,3-oxazole-4-carbaldehyde (PubChem CID 82414681) has the molecular formula C9H11NO2
and a molecular weight of 165.19 g/mol. Its IUPAC name is 5-cyclopentyl-1,3-oxazole-4-carbaldehyde.
Molecular Properties
| Compound Name | 5-cyclopentyl-1,3-oxazole-4-carbaldehyde |
| PubChem CID | 82414681 |
| Molecular Formula | C9H11NO2 |
| Molecular Weight | 165.19 g/mol |
| Exact Mass | 165.08 |
| IUPAC Name | 5-cyclopentyl-1,3-oxazole-4-carbaldehyde |
| SMILES | O=Cc1ncoc1C1CCCC1 |
| InChI | InChI=1S/C9H11NO2/c11-5-8-9(12-6-10-8)7-3-1-2-4-7/h5-7H,1-4H2 |
| InChIKey | YDYQOWGCSKKVGD-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.19 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 5-cyclopentyl-1,3-oxazole-4-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-cyclopentyl-1,3-oxazole-4-carbaldehyde?
The IUPAC name of 5-cyclopentyl-1,3-oxazole-4-carbaldehyde (CID 82414681) is 5-cyclopentyl-1,3-oxazole-4-carbaldehyde.
What is the SMILES notation for 5-cyclopentyl-1,3-oxazole-4-carbaldehyde?
The canonical SMILES for 5-cyclopentyl-1,3-oxazole-4-carbaldehyde is O=Cc1ncoc1C1CCCC1.
What is the InChIKey of 5-cyclopentyl-1,3-oxazole-4-carbaldehyde?
The InChIKey is YDYQOWGCSKKVGD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO2/c11-5-8-9(12-6-10-8)7-3-1-2-4-7/h5-7H,1-4H2.
What are the key properties of 5-cyclopentyl-1,3-oxazole-4-carbaldehyde?
5-cyclopentyl-1,3-oxazole-4-carbaldehyde has a molecular weight of 165.19 g/mol, XLogP of 2.14, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-cyclopentyl-1,3-oxazole-4-carbaldehyde is sourced from PubChem (CID 82414681), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).